Difference between revisions of "CPD-2747"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=6PGLUCONOLACT-RXN 6PGLUCONOLACT-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF ** 6-ph...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2747 CPD-2747] == * smiles: ** C1(=O)(CC[CH](N(C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O)...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=6PGLUCONOLACT-RXN 6PGLUCONOLACT-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2747 CPD-2747] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(=O)(CC[CH](N(C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))
 
* common name:
 
* common name:
−
** ORF
+
** cotinine-glucuronide
−
** 6-phosphogluconolactonase
+
* inchi key:
−
* ec number:
+
** InChIKey=XWZCZWKUGIQPJD-CVRQRIFOSA-N
−
** [http://enzyme.expasy.org/EC/3.1.1.31 EC-3.1.1.31]
+
* molecular weight:
 +
** 352.343   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[D-6-P-GLUCONO-DELTA-LACTONE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-2961]][c] '''+''' 1 [[PROTON]][c]
+
* [[RXN66-168]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 6-phospho D-glucono-1,5-lactone[c] '''+''' 1 H2O[c] '''=>''' 1 D-gluconate 6-phosphate[c] '''+''' 1 H+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_10799]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
* Gene: [[Tiso_gene_20412]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
* Gene: [[Tiso_gene_5901]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
** Source: [[orthology-creinhardtii]]
+
−
* Gene: [[Tiso_gene_15950]]
+
−
** Source: [[orthology-athaliana]]
+
−
** Source: [[orthology-athaliana]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
* Gene: [[Tiso_gene_8585]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[P122-PWY]], heterolactic fermentation: [http://metacyc.org/META/NEW-IMAGE?object=P122-PWY P122-PWY]
+
−
** '''14''' reactions found over '''18''' reactions in the full pathway
+
−
* [[RUMP-PWY]], formaldehyde oxidation I: [http://metacyc.org/META/NEW-IMAGE?object=RUMP-PWY RUMP-PWY]
+
−
** '''3''' reactions found over '''6''' reactions in the full pathway
+
−
* [[OXIDATIVEPENT-PWY]], pentose phosphate pathway (oxidative branch) I: [http://metacyc.org/META/NEW-IMAGE?object=OXIDATIVEPENT-PWY OXIDATIVEPENT-PWY]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
* [[GLYCOLYSIS-E-D]], superpathway of glycolysis and Entner-Doudoroff: [http://metacyc.org/META/NEW-IMAGE?object=GLYCOLYSIS-E-D GLYCOLYSIS-E-D]
+
−
** '''4''' reactions found over '''6''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-athaliana]]
+
−
*** Tool: [[pantograph]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
*** Tool: [[pantograph]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
−
* Category: [[manual]]
+
−
** Source: [[manual-primary_network]]
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=12556 12556]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820250 91820250]
−
* LIGAND-RXN:
+
* HMDB : HMDB01013
−
** [http://www.genome.jp/dbget-bin/www_bget?R02035 R02035]
+
{{#set: smiles=C1(=O)(CC[CH](N(C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))}}
−
* UNIPROT:
+
{{#set: common name=cotinine-glucuronide}}
−
** [http://www.uniprot.org/uniprot/P63337 P63337]
+
{{#set: inchi key=InChIKey=XWZCZWKUGIQPJD-CVRQRIFOSA-N}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: molecular weight=352.343    }}
−
{{#set: common name=ORF}}
+
{{#set: produced by=RXN66-168}}
−
{{#set: common name=6-phosphogluconolactonase}}
+
−
{{#set: ec number=EC-3.1.1.31}}
+
−
{{#set: gene associated=Tiso_gene_10799|Tiso_gene_20412|Tiso_gene_5901|Tiso_gene_15950|Tiso_gene_8585}}
+
−
{{#set: in pathway=P122-PWY|RUMP-PWY|OXIDATIVEPENT-PWY|GLYCOLYSIS-E-D}}
+
−
{{#set: reconstruction category=orthology|manual|annotation}}
+
−
{{#set: reconstruction source=annotation-experimental_annotation|orthology-esiliculosus|annotation-in-silico_annotation|orthology-athaliana|manual-primary_network|orthology-creinhardtii}}
+
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+

Latest revision as of 19:52, 21 March 2018

Metabolite CPD-2747

  • smiles:
    • C1(=O)(CC[CH](N(C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))
  • common name:
    • cotinine-glucuronide
  • inchi key:
    • InChIKey=XWZCZWKUGIQPJD-CVRQRIFOSA-N
  • molecular weight:
    • 352.343
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(=O)(CC[CH](N(C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-2747&oldid=44284"