Difference between revisions of "CPD-431"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13299 RXN-13299] == * direction: ** LEFT-TO-RIGHT * common name: ** chloroplast_beta-keto_acyl_...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-431 CPD-431] == * smiles: ** C1(C=C(O)C=CC=1C3(=CC(=O)C2(=C(C=C([O-])C=C(O)2)O3))) * common...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13299 RXN-13299] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-431 CPD-431] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(C=C(O)C=CC=1C3(=CC(=O)C2(=C(C=C([O-])C=C(O)2)O3)))
 
* common name:
 
* common name:
−
** chloroplast_beta-keto_acyl_reductase
+
** apigenin
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.1.1.330 EC-1.1.1.330]
+
** InChIKey=KZNIFHPLKGYRTM-UHFFFAOYSA-M
 +
* molecular weight:
 +
** 269.233   
 
* Synonym(s):
 
* Synonym(s):
 +
** 4',5,7-trihydroxyflavone
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-7651]]
−
** 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CPD-10283]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[CPD-14276]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 NADPH[c] '''+''' 1 H+[c] '''+''' 1 3-oxo-behenoyl-CoA[c] '''=>''' 1 NADP+[c] '''+''' 1 (3R)-3-hydroxy-behenoyl-CoA[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_9871]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-7036]], very long chain fatty acid biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7036 PWY-7036]
+
−
** '''16''' reactions found over '''16''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CAS : 520-36-5
−
{{#set: common name=chloroplast_beta-keto_acyl_reductase}}
+
* LIPID_MAPS : LMPK12110005
−
{{#set: ec number=EC-1.1.1.330}}
+
* PUBCHEM:
−
{{#set: gene associated=Tiso_gene_9871}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200950 25200950]
−
{{#set: in pathway=PWY-7036}}
+
* HMDB : HMDB02124
−
{{#set: reconstruction category=annotation}}
+
* LIGAND-CPD:
−
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01477 C01477]
−
{{#set: reconstruction tool=pathwaytools}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58470 58470]
 +
{{#set: smiles=C1(C=C(O)C=CC=1C3(=CC(=O)C2(=C(C=C([O-])C=C(O)2)O3)))}}
 +
{{#set: common name=apigenin}}
 +
{{#set: inchi key=InChIKey=KZNIFHPLKGYRTM-UHFFFAOYSA-M}}
 +
{{#set: molecular weight=269.233    }}
 +
{{#set: common name=4',5,7-trihydroxyflavone}}
 +
{{#set: consumed by=RXN-7651}}

Latest revision as of 19:52, 21 March 2018

Metabolite CPD-431

  • smiles:
    • C1(C=C(O)C=CC=1C3(=CC(=O)C2(=C(C=C([O-])C=C(O)2)O3)))
  • common name:
    • apigenin
  • inchi key:
    • InChIKey=KZNIFHPLKGYRTM-UHFFFAOYSA-M
  • molecular weight:
    • 269.233
  • Synonym(s):
    • 4',5,7-trihydroxyflavone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • CAS : 520-36-5
  • LIPID_MAPS : LMPK12110005
  • PUBCHEM:
  • HMDB : HMDB02124
  • LIGAND-CPD:
  • CHEBI:
"C1(C=C(O)C=CC=1C3(=CC(=O)C2(=C(C=C([O-])C=C(O)2)O3)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-431&oldid=44342"