Difference between revisions of "Red-NADPH-Hemoprotein-Reductases"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7524 CPD-7524] == * smiles: ** CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Red-NADPH-Hemoprotein-Reductases Red-NADPH-Hemoprotein-Reductases] == * common name: ** a reduc...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7524 CPD-7524] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Red-NADPH-Hemoprotein-Reductases Red-NADPH-Hemoprotein-Reductases] ==
−
* smiles:
+
−
** CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C)C)C)C)C
+
 
* common name:
 
* common name:
−
** 7,9,9'-cis-neurosporene
+
** a reduced [NADPH-hemoprotein reductase]
−
* inchi key:
+
−
** InChIKey=ATCICVFRSJQYDV-IFJQPPEWSA-N
+
−
* molecular weight:
+
−
** 538.898   
+
 
* Synonym(s):
 
* Synonym(s):
−
** proneurosporene
 
−
** 7,9,9'-tri-cis-neurosporene
 
−
** 7,9,9'-tricis-neurosporene
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-11357]]
+
* [[RXN66-181]]
 +
* [[HEME-OXYGENASE-DECYCLIZING-RXN]]
 +
* [[RXN66-161]]
 +
* [[RXN-8630]]
 +
* [[RXN-11057]]
 +
* [[RXN-11056]]
 +
* [[RXN66-169]]
 +
* [[RXN66-146]]
 +
* [[RXN66-163]]
 +
* [[UNSPECIFIC-MONOOXYGENASE-RXN]]
 +
* [[RXN-13064]]
 +
* [[RXN-8872]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-11356]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: common name=a reduced [NADPH-hemoprotein reductase]}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C19759 C19759]
+
{{#set: consumed by=RXN66-181|HEME-OXYGENASE-DECYCLIZING-RXN|RXN66-161|RXN-8630|RXN-11057|RXN-11056|RXN66-169|RXN66-146|RXN66-163|UNSPECIFIC-MONOOXYGENASE-RXN|RXN-13064|RXN-8872}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62463 62463]
+
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244751 25244751]
+
−
{{#set: smiles=CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C)C)C)C)C}}
+
−
{{#set: common name=7,9,9'-cis-neurosporene}}
+
−
{{#set: inchi key=InChIKey=ATCICVFRSJQYDV-IFJQPPEWSA-N}}
+
−
{{#set: molecular weight=538.898    }}
+
−
{{#set: common name=proneurosporene|7,9,9'-tri-cis-neurosporene|7,9,9'-tricis-neurosporene}}
+
−
{{#set: consumed by=RXN-11357}}
+
−
{{#set: produced by=RXN-11356}}
+

Latest revision as of 19:52, 21 March 2018

Metabolite Red-NADPH-Hemoprotein-Reductases

  • common name:
    • a reduced [NADPH-hemoprotein reductase]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a reduced [NADPH-hemoprotein reductase" cannot be used as a page name in this wiki.
Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Red-NADPH-Hemoprotein-Reductases&oldid=44363"