Difference between revisions of "RXN-14143"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-D-GLUCOSAMINE N-ACETYL-D-GLUCOSAMINE] == * smiles: ** CC(=O)NC1(C(O)OC(CO)C(O)C(O)1) *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14143 RXN-14143] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
| (4 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14143 RXN-14143] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | * ec number: | |
| − | + | ** [http://enzyme.expasy.org/EC/3.1.3.89 EC-3.1.3.89] | |
| − | * | + | |
| − | ** | + | |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | * [[ | + | ** 1 [[DUMP]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[DEOXYURIDINE]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 dUMP[c] '''+''' 1 H2O[c] '''=>''' 1 phosphate[c] '''+''' 1 2'-deoxyuridine[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_6988]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | * Gene: [[Tiso_gene_9166]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | * | + | * RHEA: |
| − | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=29358 29358] | |
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: ec number=EC-3.1.3.89}} | |
| − | + | {{#set: gene associated=Tiso_gene_6988|Tiso_gene_9166}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction source=orthology-creinhardtii}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | ||
| − | ** [http://www.ebi.ac.uk/ | + | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:37, 21 March 2018
Contents
Reaction RXN-14143
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 DUMP[c] + 1 WATER[c] => 1 Pi[c] + 1 DEOXYURIDINE[c]
- With common name(s):
- 1 dUMP[c] + 1 H2O[c] => 1 phosphate[c] + 1 2'-deoxyuridine[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_6988
- Source: orthology-creinhardtii
- Gene: Tiso_gene_9166
- Source: orthology-creinhardtii
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii
External links
- RHEA:
