Difference between revisions of "CPD-720"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LIPID-IV-A LIPID-IV-A] == * smiles: ** CCCCCCCCCCCC(O)CC(=O)NC1(C(OP([O-])([O-])=O)OC(C(O)C(OC(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-720 CPD-720] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-720 CPD-720] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34)))) |
* common name: | * common name: | ||
− | ** | + | ** 6-deoxotyphasterol |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=WPHVOXMMNSLJSF-DAWJDVIISA-N |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 434.701 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** deoxotyphasterol |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-4241]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16061346 16061346] |
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20717 20717] |
− | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15801 C15801] |
− | {{#set: smiles= | + | {{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} |
− | {{#set: common name= | + | {{#set: common name=6-deoxotyphasterol}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=WPHVOXMMNSLJSF-DAWJDVIISA-N}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=434.701 }} |
− | {{#set: common name= | + | {{#set: common name=deoxotyphasterol}} |
− | {{#set: consumed by= | + | {{#set: consumed by=RXN-4241}} |
− | + |
Latest revision as of 19:53, 21 March 2018
Contents
Metabolite CPD-720
- smiles:
- CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- common name:
- 6-deoxotyphasterol
- inchi key:
- InChIKey=WPHVOXMMNSLJSF-DAWJDVIISA-N
- molecular weight:
- 434.701
- Synonym(s):
- deoxotyphasterol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.