Difference between revisions of "CPD-716"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE INDOLE] == * smiles: ** C2(C=CC1(=C(C=CN1)C=2)) * common name: ** indole * inchi key: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-716 CPD-716] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-716 CPD-716] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34)))) |
* common name: | * common name: | ||
| − | ** | + | ** teasterone |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=SBSXXCCMIWEPEE-GZKYLSGOSA-N |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 448.685 |
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-717]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-716]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=13475125 13475125] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=26863 26863] |
| − | * | + | * LIGAND-CPD: |
| − | {{#set: smiles= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15791 C15791] |
| − | {{#set: common name= | + | {{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: common name=teasterone}} |
| − | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=SBSXXCCMIWEPEE-GZKYLSGOSA-N}} |
| − | {{#set: consumed by= | + | {{#set: molecular weight=448.685 }} |
| − | {{#set: | + | {{#set: consumed by=RXN-717}} |
| + | {{#set: produced by=RXN-716}} | ||
Latest revision as of 19:53, 21 March 2018
Contents
Metabolite CPD-716
- smiles:
- CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- common name:
- teasterone
- inchi key:
- InChIKey=SBSXXCCMIWEPEE-GZKYLSGOSA-N
- molecular weight:
- 448.685
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
