Difference between revisions of "Tiso gene 5081"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYL-PYRUVATE PHENYL-PYRUVATE] == * smiles: ** C([O-])(=O)C(=O)CC1(=CC=CC=C1) * common name:...") |
(Created page with "Category:Gene == Gene Tiso_gene_5081 == * Synonym(s): == Reactions associated == * Reaction: ADENYL-KIN-RXN ** Source: orthology-esiliculosus == Pathways associat...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_5081 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | * [[ | + | * Reaction: [[ADENYL-KIN-RXN]] |
| − | * [[ | + | ** Source: [[orthology-esiliculosus]] |
| − | == | + | == Pathways associated == |
| − | + | * [[PWY-7219]] | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=ADENYL-KIN-RXN}} | |
| − | + | {{#set: pathway associated=PWY-7219}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
Latest revision as of 19:53, 21 March 2018
Gene Tiso_gene_5081
- Synonym(s):
Reactions associated
- Reaction: ADENYL-KIN-RXN
- Source: orthology-esiliculosus
