Difference between revisions of "RXN-12399"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MPBQ MPBQ] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C=C(C)C(O)=1))C)C * common name: *...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12399 RXN-12399] == * direction: ** LEFT-TO-RIGHT * common name: ** xyloglucan XLXG oligosaccha...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MPBQ MPBQ] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12399 RXN-12399] ==
−
* smiles:
+
* direction:
−
** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C=C(C)C(O)=1))C)C
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** 2-methyl-6-phytyl-1,4-benzoquinol
+
** xyloglucan XLXG oligosaccharide β-galactosidase
−
* inchi key:
+
** glycoside_hydrolase
−
** InChIKey=GTWCNYRFOZKWTL-UOFXASEASA-N
+
** polyprotein
−
* molecular weight:
+
* ec number:
−
** 402.659   
+
** [http://enzyme.expasy.org/EC/3.2.1.23 EC-3.2.1.23]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-2542]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[WATER]][c] '''+''' 1 [[CPD-13377]][c] '''=>''' 1 [[CPD-13375]][c] '''+''' 1 [[D-galactopyranose]][c]
−
* [[RXN-2541]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 H2O[c] '''+''' 1 XLXG xyloglucan oligosaccharide[c] '''=>''' 1 XXXG xyloglucan oligosaccharide[c] '''+''' 1 D-galactopyranose[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_12839]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_17558]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_1398]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-6807]], xyloglucan degradation II (exoglucanase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6807 PWY-6807]
 +
** '''3''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15882 C15882]
+
{{#set: common name=xyloglucan XLXG oligosaccharide β-galactosidase}}
−
* HMDB : HMDB38959
+
{{#set: common name=glycoside_hydrolase}}
−
* CHEBI:
+
{{#set: common name=polyprotein}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75920 75920]
+
{{#set: ec number=EC-3.2.1.23}}
−
* METABOLIGHTS : MTBLC75920
+
{{#set: gene associated=Tiso_gene_12839|Tiso_gene_17558|Tiso_gene_1398}}
−
* PUBCHEM:
+
{{#set: in pathway=PWY-6807}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71768135 71768135]
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: smiles=CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C=C(C)C(O)=1))C)C}}
+
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
−
{{#set: common name=2-methyl-6-phytyl-1,4-benzoquinol}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: inchi key=InChIKey=GTWCNYRFOZKWTL-UOFXASEASA-N}}
+
−
{{#set: molecular weight=402.659    }}
+
−
{{#set: consumed by=RXN-2542}}
+
−
{{#set: produced by=RXN-2541}}
+

Latest revision as of 19:53, 21 March 2018

Reaction RXN-12399

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • xyloglucan XLXG oligosaccharide β-galactosidase
    • glycoside_hydrolase
    • polyprotein
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H2O[c] + 1 XLXG xyloglucan oligosaccharide[c] => 1 XXXG xyloglucan oligosaccharide[c] + 1 D-galactopyranose[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6807, xyloglucan degradation II (exoglucanase): PWY-6807
    • 3 reactions found over 6 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-12399&oldid=44437"