Difference between revisions of "RXN-14456"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1834 CPD-1834] == * smiles: ** CC(CCCC(C)C([O-])=O)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14456 RXN-14456] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/5.4...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1834 CPD-1834] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14456 RXN-14456] ==
* smiles:
+
* direction:
** CC(CCCC(C)C([O-])=O)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH]4(C(C)3CCC(O)C4))))
+
** REVERSIBLE
* common name:
+
* ec number:
** (25R)-3α,7α-dihydroxy-5-β-cholestanate
+
** [http://enzyme.expasy.org/EC/5.4.2 EC-5.4.2]
* inchi key:
+
** InChIKey=ITZYGDKGRKKBSN-RXDNHGQQSA-M
+
* molecular weight:
+
** 433.65   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-α,7-α-dihydroxy-5-β-cholestanoate
 
** 3-α,7-α-dihydroxy-5-β-cholestanate
 
** (25R)-3α,7α-dihydroxy-5-β-cholestan-26-oate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-9844]]
+
** 1 [[RIBOSE-1P]][c] '''<=>''' 1 [[CPD-15318]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 &alpha;-D-ribose-1-phosphate[c] '''<=>''' 1 &alpha;-D-ribose 5-phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_13477]]
 +
** Source: [[orthology-creinhardtii]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_4816]]
 +
** Source: [[orthology-creinhardtii]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266753 45266753]
+
{{#set: ec number=EC-5.4.2}}
* CHEBI:
+
{{#set: gene associated=Tiso_gene_13477|Tiso_gene_4816}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58750 58750]
+
{{#set: in pathway=}}
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
** [http://www.genome.jp/dbget-bin/www_bget?C04554 C04554]
+
{{#set: reconstruction source=orthology-creinhardtii}}
{{#set: smiles=CC(CCCC(C)C([O-])=O)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH]4(C(C)3CCC(O)C4))))}}
+
{{#set: reconstruction tool=pantograph}}
{{#set: common name=(25R)-3&alpha;,7&alpha;-dihydroxy-5-&beta;-cholestanate}}
+
{{#set: inchi key=InChIKey=ITZYGDKGRKKBSN-RXDNHGQQSA-M}}
+
{{#set: molecular weight=433.65    }}
+
{{#set: common name=3-&alpha;,7-&alpha;-dihydroxy-5-&beta;-cholestanoate|3-&alpha;,7-&alpha;-dihydroxy-5-&beta;-cholestanate|(25R)-3&alpha;,7&alpha;-dihydroxy-5-&beta;-cholestan-26-oate}}
+
{{#set: produced by=RXN-9844}}
+

Latest revision as of 19:53, 21 March 2018

Reaction RXN-14456

  • direction:
    • REVERSIBLE
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 α-D-ribose-1-phosphate[c] <=> 1 α-D-ribose 5-phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links