Difference between revisions of "PWY-6792"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14808 CPD-14808] == * smiles: ** C1(C(C(C(C(C1O)O)=O)O)O)O * inchi key: ** InChIKey=VYEGBDH...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6792 PWY-6792] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6792 PWY-6792] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** scopoletin biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''1''' reactions found over '''3''' reactions in the full pathway | |
− | == Reaction(s) | + | * [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]] |
− | * [ | + | ** 2 associated gene(s): |
+ | *** [[Tiso_gene_10561]] | ||
+ | *** [[Tiso_gene_14561]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12349 RXN-12349] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12350 RXN-12350] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: common name=scopoletin biosynthesis}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=3}} | |
− | {{#set: | + | {{#set: completion rate=33.0}} |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:37, 21 March 2018
Pathway PWY-6792
- taxonomic range:
- common name:
- scopoletin biosynthesis
- Synonym(s):
Reaction(s) found
1 reactions found over 3 reactions in the full pathway
- CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated: