Difference between revisions of "CPD0-2354"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4101 CPD-4101] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2354 CPD0-2354] == * common name: ** a tRNA precursor with a 5' extension * Synonym(s): =...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4101 CPD-4101] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2354 CPD0-2354] ==
* smiles:
+
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))
+
 
* common name:
 
* common name:
** 24-methylenelophenol
+
** a tRNA precursor with a 5' extension
* inchi key:
+
** InChIKey=RSMKYRDCCSNYFM-AAGDOFLISA-N
+
* molecular weight:
+
** 412.698   
+
 
* Synonym(s):
 
* Synonym(s):
** 4α-methyl-5α-ergosta-7,24-dien-3β-ol
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.1.1.143-RXN]]
+
* [[RXN0-6480]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN0-4222]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a tRNA precursor with a 5' extension}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5283640 5283640]
+
{{#set: consumed by=RXN0-6480}}
* CHEBI:
+
{{#set: produced by=RXN0-4222}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29107 29107]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C11522 C11522]
+
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: common name=24-methylenelophenol}}
+
{{#set: inchi key=InChIKey=RSMKYRDCCSNYFM-AAGDOFLISA-N}}
+
{{#set: molecular weight=412.698    }}
+
{{#set: common name=4α-methyl-5α-ergosta-7,24-dien-3β-ol}}
+
{{#set: consumed by=2.1.1.143-RXN}}
+

Latest revision as of 19:54, 21 March 2018

Metabolite CPD0-2354

  • common name:
    • a tRNA precursor with a 5' extension
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links