Difference between revisions of "Tiso gene 65"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2751 CPD-2751] == * smiles: ** C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2)) * common name: ** 5'-hydr...")
(Created page with "Category:Gene == Gene Tiso_gene_65 == * right end position: ** 42238 * transcription direction: ** POSITIVE * left end position: ** 41134 * centisome position: ** 78.07683...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2751 CPD-2751] ==
+
== Gene Tiso_gene_65 ==
−
* smiles:
+
* right end position:
−
** C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2))
+
** 42238
−
* common name:
+
* transcription direction:
−
** 5'-hydroxycotinine
+
** POSITIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=BBNHNZGTKSWIHD-SNVBAGLBSA-N
+
** 41134
−
* molecular weight:
+
* centisome position:
−
** 192.217    
+
** 78.076836    
 
* Synonym(s):
 
* Synonym(s):
−
** allohydroxycotinine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[F16ALDOLASE-RXN]]
−
* [[RXN66-163]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[FPGPL]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[RXN-8631]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[SEDOBISALDOL-RXN]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways associated ==
 +
* [[PWY-1042]]
 +
* [[P341-PWY]]
 +
* [[PWY66-399]]
 +
* [[PWY66-373]]
 +
* [[SUCSYN-PWY]]
 +
* [[GLYCOLYSIS]]
 +
* [[PWY-7385]]
 +
* [[ANAGLYCOLYSIS-PWY]]
 +
* [[CALVIN-PWY]]
 +
* [[PWY0-1517]]
 +
* [[PWY-1861]]
 +
* [[PWY-6142]]
 +
* [[PWY-5484]]
 +
* [[P185-PWY]]
 +
* [[GLUCONEO-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=42238}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9815515 9815515]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEMSPIDER:
+
{{#set: left end position=41134}}
−
** [http://www.chemspider.com/Chemical-Structure.7991265.html 7991265]
+
{{#set: centisome position=78.076836   }}
−
* HMDB : HMDB01427
+
{{#set: reaction associated=F16ALDOLASE-RXN|FPGPL|RXN-8631|SEDOBISALDOL-RXN}}
−
{{#set: smiles=C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2))}}
+
{{#set: pathway associated=PWY-1042|P341-PWY|PWY66-399|PWY66-373|SUCSYN-PWY|GLYCOLYSIS|PWY-7385|ANAGLYCOLYSIS-PWY|CALVIN-PWY|PWY0-1517|PWY-1861|PWY-6142|PWY-5484|P185-PWY|GLUCONEO-PWY}}
−
{{#set: common name=5'-hydroxycotinine}}
+
−
{{#set: inchi key=InChIKey=BBNHNZGTKSWIHD-SNVBAGLBSA-N}}
+
−
{{#set: molecular weight=192.217   }}
+
−
{{#set: common name=allohydroxycotinine}}
+
−
{{#set: produced by=RXN66-163}}
+

Latest revision as of 19:54, 21 March 2018

Gene Tiso_gene_65

  • right end position:
    • 42238
  • transcription direction:
    • POSITIVE
  • left end position:
    • 41134
  • centisome position:
    • 78.076836
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_65&oldid=44563"