Difference between revisions of "Tiso gene 4021"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-7-DIMETHYLXANTHINE 3-7-DIMETHYLXANTHINE] == * smiles: ** CN2(C=NC1(=C(C(NC(N(C)1)=O)=O)2)) *...") |
(Created page with "Category:Gene == Gene Tiso_gene_4021 == * Synonym(s): == Reactions associated == * Reaction: RXN-11839 ** Source: annotation-in-silico_annotation *** Assignment:...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_4021 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[RXN-11839]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: automated-name-match |
+ | * Reaction: [[RXN-11840]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-11841]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-11842]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=RXN-11839|RXN-11840|RXN-11841|RXN-11842|TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Latest revision as of 20:54, 21 March 2018
Gene Tiso_gene_4021
- Synonym(s):
Reactions associated
- Reaction: RXN-11839
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
- Reaction: RXN-11840
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
- Reaction: RXN-11841
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
- Reaction: RXN-11842
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
- Reaction: TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation