Difference between revisions of "3Prime-OH-Terminated-RNAs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYCLOARTENOL CYCLOARTENOL] == * smiles: ** CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3Prime-OH-Terminated-RNAs 3Prime-OH-Terminated-RNAs] == * common name: ** an [RNA]-3'-hydroxyl...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYCLOARTENOL CYCLOARTENOL] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3Prime-OH-Terminated-RNAs 3Prime-OH-Terminated-RNAs] ==
* smiles:
+
** CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))
+
* inchi key:
+
** InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N
+
 
* common name:
 
* common name:
** cycloartenol
+
** an [RNA]-3'-hydroxyl
* molecular weight:
+
** 426.724   
+
 
* Synonym(s):
 
* Synonym(s):
** 9β,19-cyclo-24-lanosten-3β-ol
+
** a 5'-hydroxyl terminated RNA
** cycloart-24(25)-enol
+
** 5'-hydroxy-[RNA]
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-4021]]
+
* [[RXN-17927]]
 +
* [[RNA-LIGASE-ATP-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[CYCLOARTENOL-SYNTHASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* CAS : 469-38-5
+
{{#set: common name=an [RNA]-3'-hydroxyl}}
* PUBCHEM:
+
{{#set: common name=a 5'-hydroxyl terminated RNA|5'-hydroxy-[RNA]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44434254 44434254]
+
{{#set: consumed by=RXN-17927|RNA-LIGASE-ATP-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17030 17030]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C01902 C01902]
+
* HMDB : HMDB36591
+
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))}}
+
{{#set: inchi key=InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N}}
+
{{#set: common name=cycloartenol}}
+
{{#set: molecular weight=426.724    }}
+
{{#set: common name=9β,19-cyclo-24-lanosten-3β-ol|cycloart-24(25)-enol}}
+
{{#set: consumed by=RXN-4021}}
+
{{#set: produced by=CYCLOARTENOL-SYNTHASE-RXN}}
+

Latest revision as of 19:37, 21 March 2018

Metabolite 3Prime-OH-Terminated-RNAs

  • common name:
    • an [RNA]-3'-hydroxyl
  • Synonym(s):
    • a 5'-hydroxyl terminated RNA
    • 5'-hydroxy-[RNA]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an [RNA]-3'-hydroxyl" cannot be used as a page name in this wiki.
"5'-hydroxy-[RNA" cannot be used as a page name in this wiki.