Difference between revisions of "CPD-564"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XYLULOSE-5-PHOSPHATE XYLULOSE-5-PHOSPHATE] == * smiles: ** C(OP([O-])(=O)[O-])C(O)C(O)C(=O)CO *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-564 CPD-564] == * smiles: ** C(CC([N+])C(=O)[O-])SCC1(OC(O)C(O)C(O)1) * common name: ** S-r...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-564 CPD-564] == |
* smiles: | * smiles: | ||
| − | ** C( | + | ** C(CC([N+])C(=O)[O-])SCC1(OC(O)C(O)C(O)1) |
* common name: | * common name: | ||
| − | ** | + | ** S-ribosyl-L-homocysteine |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=IQFWYNFDWRYSRA-OEQWSMLSSA-N |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 267.296 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** S-Ribosylhomocysteine |
| − | ** | + | ** Ribose-5-S-homocysteine |
| − | ** D- | + | ** S-D-ribosyl-L-homocysteine |
| − | ** | + | ** ribose-5-S-homocysteine |
| + | ** S-ribosylhomocysteine | ||
| + | ** S-(5-deoxy-D-ribos-5-yl)-L-homocysteine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ADENOSYLHOMOCYSTEINE-NUCLEOSIDASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== External links == | == External links == | ||
| − | * CAS : | + | * CAS : 37558-16-0 |
| − | + | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245776 25245776] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17575 17575] |
| − | * | + | * BIGG : rhcys |
| − | {{#set: smiles=C( | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03539 C03539] |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=C(CC([N+])C(=O)[O-])SCC1(OC(O)C(O)C(O)1)}} |
| − | {{#set: molecular weight= | + | {{#set: common name=S-ribosyl-L-homocysteine}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=IQFWYNFDWRYSRA-OEQWSMLSSA-N}} |
| − | {{#set: produced by= | + | {{#set: molecular weight=267.296 }} |
| − | + | {{#set: common name=S-Ribosylhomocysteine|Ribose-5-S-homocysteine|S-D-ribosyl-L-homocysteine|ribose-5-S-homocysteine|S-ribosylhomocysteine|S-(5-deoxy-D-ribos-5-yl)-L-homocysteine}} | |
| + | {{#set: produced by=ADENOSYLHOMOCYSTEINE-NUCLEOSIDASE-RXN}} | ||
Latest revision as of 19:56, 21 March 2018
Contents
Metabolite CPD-564
- smiles:
- C(CC([N+])C(=O)[O-])SCC1(OC(O)C(O)C(O)1)
- common name:
- S-ribosyl-L-homocysteine
- inchi key:
- InChIKey=IQFWYNFDWRYSRA-OEQWSMLSSA-N
- molecular weight:
- 267.296
- Synonym(s):
- S-Ribosylhomocysteine
- Ribose-5-S-homocysteine
- S-D-ribosyl-L-homocysteine
- ribose-5-S-homocysteine
- S-ribosylhomocysteine
- S-(5-deoxy-D-ribos-5-yl)-L-homocysteine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(CC([N+])C(=O)[O-])SCC1(OC(O)C(O)C(O)1)" cannot be used as a page name in this wiki.
