Difference between revisions of "Tiso gene 2166"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIS-ACONITATE CIS-ACONITATE] == * smiles: ** C([O-])(=O)C(=CC(=O)[O-])CC(=O)[O-] * common name:...") |
(Created page with "Category:Gene == Gene Tiso_gene_2166 == * right end position: ** 8814 * transcription direction: ** POSITIVE * left end position: ** 6922 * centisome position: ** 34.06831...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_2166 == |
− | * | + | * right end position: |
− | ** | + | ** 8814 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 6922 |
− | * | + | * centisome position: |
− | ** | + | ** 34.068314 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[PEPTIDYLPROLYL-ISOMERASE-RXN]] | |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[ | + | *** Assignment: automated-name-match |
− | * [[ | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: right end position=8814}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=6922}} | |
− | + | {{#set: centisome position=34.068314 }} | |
− | + | {{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:56, 21 March 2018
Gene Tiso_gene_2166
- right end position:
- 8814
- transcription direction:
- POSITIVE
- left end position:
- 6922
- centisome position:
- 34.068314
- Synonym(s):
Reactions associated
- Reaction: PEPTIDYLPROLYL-ISOMERASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation