Difference between revisions of "UDP-D-GALACTURONATE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_19107 == * right end position: ** 2235 * transcription direction: ** POSITIVE * left end position: ** 1092 * centisome position: ** 42.4242...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-D-GALACTURONATE UDP-D-GALACTURONATE] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OC1(OC(C(=O)...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-D-GALACTURONATE UDP-D-GALACTURONATE] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(OP(=O)([O-])OP(=O)([O-])OC1(OC(C(=O)[O-])C(O)C(O)C(O)1))C2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3)) |
| − | * | + | * common name: |
| − | ** | + | ** UDP-α-D-galacturonate |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=HDYANYHVCAPMJV-GXNRKQDOSA-K |
| − | * | + | * molecular weight: |
| − | ** | + | ** 577.265 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[UDPGALor]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[UDP-GLUCURONATE-4-EPIMERASE-RXN]] | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244587 25244587] |
| − | {{#set: | + | * HMDB : HMDB12302 |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: reaction associated= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57635 57635] |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00617 C00617] | ||
| + | {{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OC1(OC(C(=O)[O-])C(O)C(O)C(O)1))C2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3))}} | ||
| + | {{#set: common name=UDP-α-D-galacturonate}} | ||
| + | {{#set: inchi key=InChIKey=HDYANYHVCAPMJV-GXNRKQDOSA-K}} | ||
| + | {{#set: molecular weight=577.265 }} | ||
| + | {{#set: produced by=UDPGALor}} | ||
| + | {{#set: reversible reaction associated=UDP-GLUCURONATE-4-EPIMERASE-RXN}} | ||
Latest revision as of 19:57, 21 March 2018
Contents
Metabolite UDP-D-GALACTURONATE
- smiles:
- C(OP(=O)([O-])OP(=O)([O-])OC1(OC(C(=O)[O-])C(O)C(O)C(O)1))C2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3))
- common name:
- UDP-α-D-galacturonate
- inchi key:
- InChIKey=HDYANYHVCAPMJV-GXNRKQDOSA-K
- molecular weight:
- 577.265
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])OP(=O)([O-])OC1(OC(C(=O)[O-])C(O)C(O)C(O)1))C2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3))" cannot be used as a page name in this wiki.
