Difference between revisions of "CREATINASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4211 CPD-4211] == * smiles: ** CC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-] * common name: ** dimet...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CREATINASE-RXN CREATINASE-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expa...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CREATINASE-RXN CREATINASE-RXN] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/3.5.3.3 EC-3.5.3.3] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | + | ** 1 [[CREATINE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[SARCOSINE]][c] '''+''' 1 [[UREA]][c] | |
| − | + | * With common name(s): | |
| − | * [[ | + | ** 1 creatine[c] '''+''' 1 H2O[c] '''=>''' 1 sarcosine[c] '''+''' 1 urea[c] |
| − | == | + | |
| − | * [[ | + | == Genes associated with this reaction == |
| − | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
| − | * [[ | + | * Gene: [[Tiso_gene_14456]] |
| − | == | + | ** Source: [[orthology-esiliculosus]] |
| − | * [[ | + | == Pathways == |
| − | * [[ | + | * [[CRNFORCAT-PWY]], creatinine degradation I: [http://metacyc.org/META/NEW-IMAGE?object=CRNFORCAT-PWY CRNFORCAT-PWY] |
| + | ** '''2''' reactions found over '''4''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | * | + | * RHEA: |
| − | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22456 22456] | |
| − | + | * LIGAND-RXN: | |
| − | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01566 R01566] |
| − | + | * UNIPROT: | |
| − | * LIGAND- | + | ** [http://www.uniprot.org/uniprot/P38487 P38487] |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.uniprot.org/uniprot/P19213 P19213] |
| − | * | + | {{#set: direction=LEFT-TO-RIGHT}} |
| − | ** [http://www. | + | {{#set: ec number=EC-3.5.3.3}} |
| − | + | {{#set: gene associated=Tiso_gene_14456}} | |
| − | ** [http://www. | + | {{#set: in pathway=CRNFORCAT-PWY}} |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | {{#set: | + | {{#set: reconstruction source=orthology-esiliculosus}} |
| − | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:57, 21 March 2018
Contents
Reaction CREATINASE-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 creatine[c] + 1 H2O[c] => 1 sarcosine[c] + 1 urea[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_14456
- Source: orthology-esiliculosus
Pathways
- CRNFORCAT-PWY, creatinine degradation I: CRNFORCAT-PWY
- 2 reactions found over 4 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
External links
