Difference between revisions of "DTDP-DEOH-DEOXY-MANNOSE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-774 RXN-774] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1.14...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-DEOH-DEOXY-MANNOSE DTDP-DEOH-DEOXY-MANNOSE] == * smiles: ** CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-774 RXN-774] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-DEOH-DEOXY-MANNOSE DTDP-DEOH-DEOXY-MANNOSE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(C)C(=O)C(O)C(O)2))O3))
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/1.14.99 EC-1.14.99]
+
** dTDP-4-dehydro-β-L-rhamnose
 +
* inchi key:
 +
** InChIKey=PSXWNITXWWECNY-LPVGZGSHSA-L
 +
* molecular weight:
 +
** 544.302   
 
* Synonym(s):
 
* Synonym(s):
 +
** dTDP-4-oxo-6-deoxy-β-L-mannose
 +
** dTDP-4-oxo-β-L-rhamnose
 +
** dTDP-4-dehydro-6-deoxy-β-L-mannose
 +
** dTDP-4-keto-L-rhamnose
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[DTDPDEHYRHAMREDUCT-RXN]]
−
** 1 [[CPD-712]][c] '''+''' 1 [[Donor-H2]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[CPD-715]][c] '''+''' 1 [[Acceptor]][c] '''+''' 1 [[WATER]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 6-deoxocathasterone[c] '''+''' 1 a reduced electron acceptor[c] '''+''' 1 oxygen[c] '''=>''' 1 6-deoxoteasterone[c] '''+''' 1 an oxidized electron acceptor[c] '''+''' 1 H2O[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_8263]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
* Gene: [[Tiso_gene_3577]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-2582]], brassinosteroid biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2582 PWY-2582]
+
−
** '''7''' reactions found over '''21''' reactions in the full pathway
+
−
* [[PWY-699]], brassinosteroid biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-699 PWY-699]
+
−
** '''11''' reactions found over '''25''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R07448 R07448]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53356769 53356769]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
−
{{#set: ec number=EC-1.14.99}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62830 62830]
−
{{#set: gene associated=Tiso_gene_8263|Tiso_gene_3577}}
+
* BIGG : dtdp4d6dm
−
{{#set: in pathway=PWY-2582|PWY-699}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00688 C00688]
−
{{#set: reconstruction source=orthology-esiliculosus}}
+
{{#set: smiles=CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(C)C(=O)C(O)C(O)2))O3))}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: common name=dTDP-4-dehydro-β-L-rhamnose}}
 +
{{#set: inchi key=InChIKey=PSXWNITXWWECNY-LPVGZGSHSA-L}}
 +
{{#set: molecular weight=544.302    }}
 +
{{#set: common name=dTDP-4-oxo-6-deoxy-β-L-mannose|dTDP-4-oxo-β-L-rhamnose|dTDP-4-dehydro-6-deoxy-β-L-mannose|dTDP-4-keto-L-rhamnose}}
 +
{{#set: consumed by=DTDPDEHYRHAMREDUCT-RXN}}

Latest revision as of 19:59, 21 March 2018

Metabolite DTDP-DEOH-DEOXY-MANNOSE

  • smiles:
    • CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(C)C(=O)C(O)C(O)2))O3))
  • common name:
    • dTDP-4-dehydro-β-L-rhamnose
  • inchi key:
    • InChIKey=PSXWNITXWWECNY-LPVGZGSHSA-L
  • molecular weight:
    • 544.302
  • Synonym(s):
    • dTDP-4-oxo-6-deoxy-β-L-mannose
    • dTDP-4-oxo-β-L-rhamnose
    • dTDP-4-dehydro-6-deoxy-β-L-mannose
    • dTDP-4-keto-L-rhamnose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(C)C(=O)C(O)C(O)2))O3))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=DTDP-DEOH-DEOXY-MANNOSE&oldid=45053"