Difference between revisions of "Primary-Alcohols"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13172 CPD-13172] == * smiles: ** C(=O)(C1(O)(C=CCCC(=O)1))[O-] * common name: ** 6-hydroxy-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Primary-Alcohols Primary-Alcohols] == * common name: ** a primary alcohol * Synonym(s): ** 1-Al...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Primary-Alcohols Primary-Alcohols] == |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a primary alcohol |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 1-Alcohol |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[ALCOHOL-DEHYDROG-GENERIC-RXN]] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a primary alcohol}} | |
| − | + | {{#set: common name=1-Alcohol}} | |
| − | {{#set: | + | {{#set: reversible reaction associated=ALCOHOL-DEHYDROG-GENERIC-RXN}} |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
Latest revision as of 20:01, 21 March 2018
Contents
Metabolite Primary-Alcohols
- common name:
- a primary alcohol
- Synonym(s):
- 1-Alcohol
