Difference between revisions of "NICOTINE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_2906 == * right end position: ** 3203 * transcription direction: ** NEGATIVE * left end position: ** 356 * centisome position: ** 1.9782175...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NICOTINE NICOTINE] == * smiles: ** C1(CC[CH]([N+](C)1)C2(C=NC=CC=2)) * common name: ** (S)-nico...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NICOTINE NICOTINE] == |
| − | * | + | * smiles: |
| − | ** | + | ** C1(CC[CH]([N+](C)1)C2(C=NC=CC=2)) |
| − | * | + | * common name: |
| − | ** | + | ** (S)-nicotine |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=SNICXCGAKADSCV-JTQLQIEISA-O |
| − | * | + | * molecular weight: |
| − | ** | + | ** 163.242 |
* Synonym(s): | * Synonym(s): | ||
| + | ** nicotine | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN66-81]] |
| − | * | + | * [[RXN66-146]] |
| − | * | + | * [[RXN66-83]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6919000 6919000] |
| − | {{#set: | + | * NCI: |
| − | {{#set: | + | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=5065 5065] |
| − | {{#set: | + | * HMDB : HMDB01934 |
| − | {{#set: | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00745 C00745] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.5294163.html 5294163] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59806 59806] | ||
| + | {{#set: smiles=C1(CC[CH]([N+](C)1)C2(C=NC=CC=2))}} | ||
| + | {{#set: common name=(S)-nicotine}} | ||
| + | {{#set: inchi key=InChIKey=SNICXCGAKADSCV-JTQLQIEISA-O}} | ||
| + | {{#set: molecular weight=163.242 }} | ||
| + | {{#set: common name=nicotine}} | ||
| + | {{#set: consumed by=RXN66-81|RXN66-146|RXN66-83}} | ||
Latest revision as of 20:02, 21 March 2018
Contents
Metabolite NICOTINE
- smiles:
- C1(CC[CH]([N+](C)1)C2(C=NC=CC=2))
- common name:
- (S)-nicotine
- inchi key:
- InChIKey=SNICXCGAKADSCV-JTQLQIEISA-O
- molecular weight:
- 163.242
- Synonym(s):
- nicotine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(CC[CH]([N+](C)1)C2(C=NC=CC=2))" cannot be used as a page name in this wiki.
