Difference between revisions of "DTDP-RHAMNOSE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-VAL-tRNAs Charged-VAL-tRNAs] == * common name: ** an L-valyl-[tRNAval] * Synonym(s): =...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-RHAMNOSE DTDP-RHAMNOSE] == * smiles: ** CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-RHAMNOSE DTDP-RHAMNOSE] == |
| + | * smiles: | ||
| + | ** CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(C)C(O)C(O)C(O)2))O3)) | ||
* common name: | * common name: | ||
| − | ** | + | ** dTDP-β-L-rhamnose |
| + | * inchi key: | ||
| + | ** InChIKey=ZOSQFDVXNQFKBY-CGAXJHMRSA-L | ||
| + | * molecular weight: | ||
| + | ** 546.317 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** dTDP-6-deoxy-β-L-mannose | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[DTDPDEHYRHAMREDUCT-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * CAS : 572-96-3 |
| − | {{#set: | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245982 25245982] | ||
| + | * HMDB : HMDB06354 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C03319 C03319] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57510 57510] | ||
| + | * BIGG : dtdprmn | ||
| + | {{#set: smiles=CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(C)C(O)C(O)C(O)2))O3))}} | ||
| + | {{#set: common name=dTDP-β-L-rhamnose}} | ||
| + | {{#set: inchi key=InChIKey=ZOSQFDVXNQFKBY-CGAXJHMRSA-L}} | ||
| + | {{#set: molecular weight=546.317 }} | ||
| + | {{#set: common name=dTDP-6-deoxy-β-L-mannose}} | ||
| + | {{#set: produced by=DTDPDEHYRHAMREDUCT-RXN}} | ||
Latest revision as of 20:02, 21 March 2018
Contents
Metabolite DTDP-RHAMNOSE
- smiles:
- CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(C)C(O)C(O)C(O)2))O3))
- common name:
- dTDP-β-L-rhamnose
- inchi key:
- InChIKey=ZOSQFDVXNQFKBY-CGAXJHMRSA-L
- molecular weight:
- 546.317
- Synonym(s):
- dTDP-6-deoxy-β-L-mannose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(C)C(O)C(O)C(O)2))O3))" cannot be used as a page name in this wiki.
