Difference between revisions of "CPD0-1905"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_15914 == * Synonym(s): == Reactions associated == * Reaction: 2.5.1.32-RXN ** Source: orthology-synechocystis ** Source: ortholo...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1905 CPD0-1905] == * smiles: ** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1905 CPD0-1905] == |
| + | * smiles: | ||
| + | ** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23))) | ||
| + | * common name: | ||
| + | ** 8-oxo-dGTP | ||
| + | * inchi key: | ||
| + | ** InChIKey=BUZOGVVQWCXXDP-VPENINKCSA-J | ||
| + | * molecular weight: | ||
| + | ** 519.151 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 8-oxo-7,8-dihydro-2'-dGTP | ||
| + | ** 8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-triphosphate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[RXN-11410]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-14205]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237341 44237341] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77896 77896] | ||
| + | {{#set: smiles=C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))}} | ||
| + | {{#set: common name=8-oxo-dGTP}} | ||
| + | {{#set: inchi key=InChIKey=BUZOGVVQWCXXDP-VPENINKCSA-J}} | ||
| + | {{#set: molecular weight=519.151 }} | ||
| + | {{#set: common name=8-oxo-7,8-dihydro-2'-dGTP|8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-triphosphate}} | ||
| + | {{#set: produced by=RXN-11410}} | ||
| + | {{#set: reversible reaction associated=RXN-14205}} | ||
Latest revision as of 20:03, 21 March 2018
Contents
Metabolite CPD0-1905
- smiles:
- C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))
- common name:
- 8-oxo-dGTP
- inchi key:
- InChIKey=BUZOGVVQWCXXDP-VPENINKCSA-J
- molecular weight:
- 519.151
- Synonym(s):
- 8-oxo-7,8-dihydro-2'-dGTP
- 8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-triphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))" cannot be used as a page name in this wiki.
