Difference between revisions of "CARBOXYMETHYLENEBUTENOLIDASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12014 CPD-12014] == * smiles: ** CC(=O)NCCC1(=CNC2(C1=CC(OC)=C(O)C=2)) * common name: ** 6-...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CARBOXYMETHYLENEBUTENOLIDASE-RXN CARBOXYMETHYLENEBUTENOLIDASE-RXN] == * direction: ** LEFT-TO-RIGHT...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CARBOXYMETHYLENEBUTENOLIDASE-RXN CARBOXYMETHYLENEBUTENOLIDASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
* common name: | * common name: | ||
− | ** | + | ** carboxymethylenebutenolidase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.1.1.45 EC-3.1.1.45] |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 1 [[WATER]][c] '''+''' 1 [[4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[CPD-294]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 H2O[c] '''+''' 1 cis-dienelactone[c] '''=>''' 1 H+[c] '''+''' 1 2-maleylacetate[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_12835]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[PWY-6087]], 4-chlorocatechol degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6087 PWY-6087] | ||
+ | ** '''1''' reactions found over '''5''' reactions in the full pathway | ||
+ | * [[PWY-6193]], 3-chlorocatechol degradation II (ortho): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6193 PWY-6193] | ||
+ | ** '''1''' reactions found over '''5''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=12372 12372] |
− | + | * LIGAND-RXN: | |
− | * LIGAND- | + | ** [http://www.genome.jp/dbget-bin/www_bget?R03893 R03893] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/P0A114 P0A114] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P27136 P27136] |
− | * | + | ** [http://www.uniprot.org/uniprot/P27100 P27100] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P0A115 P0A115] |
− | * | + | ** [http://www.uniprot.org/uniprot/P73163 P73163] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9RPF5 Q9RPF5] |
− | {{#set: common name= | + | ** [http://www.uniprot.org/uniprot/Q9RPB2 Q9RPB2] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: | + | {{#set: common name=carboxymethylenebutenolidase}} |
− | {{#set: | + | {{#set: ec number=EC-3.1.1.45}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_12835}} |
+ | {{#set: in pathway=PWY-6087|PWY-6193}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-in-silico_annotation}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 21:04, 21 March 2018
Contents
Reaction CARBOXYMETHYLENEBUTENOLIDASE-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- carboxymethylenebutenolidase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE[c] => 1 PROTON[c] + 1 CPD-294[c]
- With common name(s):
- 1 H2O[c] + 1 cis-dienelactone[c] => 1 H+[c] + 1 2-maleylacetate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_12835
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
Pathways
- PWY-6087, 4-chlorocatechol degradation: PWY-6087
- 1 reactions found over 5 reactions in the full pathway
- PWY-6193, 3-chlorocatechol degradation II (ortho): PWY-6193
- 1 reactions found over 5 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links