Difference between revisions of "PROUT-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMINOASPARTATE IMINOASPARTATE] == * smiles: ** C(=O)([O-])CC(=N)C(=O)[O-] * inchi key: ** InChI...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PROUT-PWY PROUT-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-...") |
||
(4 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PROUT-PWY PROUT-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
* common name: | * common name: | ||
− | ** | + | ** L-proline degradation |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** L-proline utilization |
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''3''' reactions found over '''3''' reactions in the full pathway | |
− | * [[ | + | * [[RXN-14116]] |
− | == Reaction(s) | + | ** 8 associated gene(s): |
+ | *** [[Tiso_gene_6952]] | ||
+ | *** [[Tiso_gene_3513]] | ||
+ | *** [[Tiso_gene_7381]] | ||
+ | *** [[Tiso_gene_16634]] | ||
+ | *** [[Tiso_gene_18338]] | ||
+ | *** [[Tiso_gene_886]] | ||
+ | *** [[Tiso_gene_9680]] | ||
+ | *** [[Tiso_gene_18337]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | * [[RXN-14903]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Tiso_gene_18826]] | ||
+ | *** [[Tiso_gene_18825]] | ||
+ | *** [[Tiso_gene_9762]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[SPONTPRO-RXN]] | ||
+ | ** 0 associated gene: | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: taxonomic range=TAX-2157}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=L-proline degradation}} | |
− | + | {{#set: common name=L-proline utilization}} | |
− | + | {{#set: reaction found=3}} | |
− | + | {{#set: total reaction=3}} | |
− | + | {{#set: completion rate=100.0}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:38, 21 March 2018
Pathway PROUT-PWY
- taxonomic range:
- common name:
- L-proline degradation
- Synonym(s):
- L-proline utilization
Reaction(s) found
3 reactions found over 3 reactions in the full pathway
- RXN-14116
- 8 associated gene(s):
- 3 reconstruction source(s) associated:
- RXN-14903
- 3 associated gene(s):
- 2 reconstruction source(s) associated:
- SPONTPRO-RXN
- 0 associated gene:
- 2 reconstruction source(s) associated: