Difference between revisions of "Tiso gene 7915"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-CTP 5-HYDROXY-CTP] == * smiles: ** C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP...")
(Created page with "Category:Gene == Gene Tiso_gene_7915 == * right end position: ** 10661 * transcription direction: ** NEGATIVE * left end position: ** 6318 * centisome position: ** 59.0743...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-CTP 5-HYDROXY-CTP] ==
+
== Gene Tiso_gene_7915 ==
−
* smiles:
+
* right end position:
−
** C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O
+
** 10661
−
* common name:
+
* transcription direction:
−
** 5-hydroxy-CTP
+
** NEGATIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=DMFODUNDODUQKK-UAKXSSHOSA-J
+
** 6318
−
* molecular weight:
+
* centisome position:
−
** 495.126    
+
** 59.074337    
 
* Synonym(s):
 
* Synonym(s):
−
** 5-hydroxycytidine triphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-12086]]
−
* [[RXN0-7080]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[RXN-12579]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[TRIACYLGLYCEROL-LIPASE-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[LIPAS-PWY]]
 +
* [[PWY-6857]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=10661}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202584 25202584]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O}}
+
{{#set: left end position=6318}}
−
{{#set: common name=5-hydroxy-CTP}}
+
{{#set: centisome position=59.074337   }}
−
{{#set: inchi key=InChIKey=DMFODUNDODUQKK-UAKXSSHOSA-J}}
+
{{#set: reaction associated=RXN-12086|RXN-12579|TRIACYLGLYCEROL-LIPASE-RXN}}
−
{{#set: molecular weight=495.126   }}
+
{{#set: pathway associated=LIPAS-PWY|PWY-6857}}
−
{{#set: common name=5-hydroxycytidine triphosphate}}
+
−
{{#set: produced by=RXN0-7080}}
+

Latest revision as of 20:05, 21 March 2018

Gene Tiso_gene_7915

  • right end position:
    • 10661
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 6318
  • centisome position:
    • 59.074337
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_7915&oldid=45796"