Difference between revisions of "Tiso gene 13820"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10608 CPD-10608] == * smiles: ** C1(=CC(=O)OC(=CC(=O)[O-])1) * inchi key: ** InChIKey=AYFXP...")
 
(Created page with "Category:Gene == Gene Tiso_gene_13820 == * right end position: ** 5203 * transcription direction: ** POSITIVE * left end position: ** 150 * centisome position: ** 2.483443...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10608 CPD-10608] ==
+
== Gene Tiso_gene_13820 ==
−
* smiles:
+
* right end position:
−
** C1(=CC(=O)OC(=CC(=O)[O-])1)
+
** 5203
−
* inchi key:
+
* transcription direction:
−
** InChIKey=AYFXPGXAZMFWNH-ONEGZZNKSA-M
+
** POSITIVE
−
* common name:
+
* left end position:
−
** trans-dienelactone
+
** 150
−
* molecular weight:
+
* centisome position:
−
** 139.087    
+
** 2.4834437    
 
* Synonym(s):
 
* Synonym(s):
−
** 2-trans-dienelactone
 
−
** trans-4-carboxymethylenebut-2-en-1,4-olide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-9868]]
+
* Reaction: [[GLUTAMINESYN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[orthology-synechocystis]]
 +
== Pathways associated ==
 +
* [[GLNSYN-PWY]]
 +
* [[PWY-5675]]
 +
* [[PWY-381]]
 +
* [[PWY-6549]]
 +
* [[PWY-6964]]
 +
* [[PWY490-3]]
 +
* [[PWY-6963]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=5203}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9543248 9543248]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEMSPIDER:
+
{{#set: left end position=150}}
−
** [http://www.chemspider.com/Chemical-Structure.7822189.html 7822189]
+
{{#set: centisome position=2.4834437   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=GLUTAMINESYN-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C12838 C12838]
+
{{#set: pathway associated=GLNSYN-PWY|PWY-5675|PWY-381|PWY-6549|PWY-6964|PWY490-3|PWY-6963}}
−
{{#set: smiles=C1(=CC(=O)OC(=CC(=O)[O-])1)}}
+
−
{{#set: inchi key=InChIKey=AYFXPGXAZMFWNH-ONEGZZNKSA-M}}
+
−
{{#set: common name=trans-dienelactone}}
+
−
{{#set: molecular weight=139.087   }}
+
−
{{#set: common name=2-trans-dienelactone|trans-4-carboxymethylenebut-2-en-1,4-olide}}
+
−
{{#set: consumed by=RXN-9868}}
+

Latest revision as of 19:38, 21 March 2018

Gene Tiso_gene_13820

  • right end position:
    • 5203
  • transcription direction:
    • POSITIVE
  • left end position:
    • 150
  • centisome position:
    • 2.4834437
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_13820&oldid=42896"