Difference between revisions of "Tiso gene 13820"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10608 CPD-10608] == * smiles: ** C1(=CC(=O)OC(=CC(=O)[O-])1) * inchi key: ** InChIKey=AYFXP...") |
(Created page with "Category:Gene == Gene Tiso_gene_13820 == * right end position: ** 5203 * transcription direction: ** POSITIVE * left end position: ** 150 * centisome position: ** 2.483443...") |
||
(4 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_13820 == |
− | * | + | * right end position: |
− | ** | + | ** 5203 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 150 |
− | * | + | * centisome position: |
− | ** | + | ** 2.4834437 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[GLUTAMINESYN-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: ec-number |
+ | ** Source: [[orthology-synechocystis]] | ||
+ | == Pathways associated == | ||
+ | * [[GLNSYN-PWY]] | ||
+ | * [[PWY-5675]] | ||
+ | * [[PWY-381]] | ||
+ | * [[PWY-6549]] | ||
+ | * [[PWY-6964]] | ||
+ | * [[PWY490-3]] | ||
+ | * [[PWY-6963]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=5203}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=150}} | |
− | + | {{#set: centisome position=2.4834437 }} | |
− | + | {{#set: reaction associated=GLUTAMINESYN-RXN}} | |
− | + | {{#set: pathway associated=GLNSYN-PWY|PWY-5675|PWY-381|PWY-6549|PWY-6964|PWY490-3|PWY-6963}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:38, 21 March 2018
Gene Tiso_gene_13820
- right end position:
- 5203
- transcription direction:
- POSITIVE
- left end position:
- 150
- centisome position:
- 2.4834437
- Synonym(s):
Reactions associated
- Reaction: GLUTAMINESYN-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-synechocystis
- Source: annotation-in-silico_annotation