Difference between revisions of "RXN-9952"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7682 CPD-7682] == * smiles: ** C(C1(CCCC=N1))([O-])=O * common name: ** (S)-2,3,4,5-tetrahy...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9952 RXN-9952] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-hydroxyisobutyrate_mitochon...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7682 CPD-7682] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9952 RXN-9952] ==
−
* smiles:
+
* direction:
−
** C(C1(CCCC=N1))([O-])=O
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** (S)-2,3,4,5-tetrahydropiperidine-2-carboxylate
+
** 3-hydroxyisobutyrate_mitochondrial
−
* inchi key:
+
** 6-phosphogluconate_decarboxylating
−
** InChIKey=CSDPVAKVEWETFG-YFKPBYRVSA-M
+
** ORF
−
* molecular weight:
+
* ec number:
−
** 126.135   
+
** [http://enzyme.expasy.org/EC/1.1.1.44 EC-1.1.1.44]
 
* Synonym(s):
 
* Synonym(s):
−
** Δ1-piperideine-6-carboxylate
 
−
** Δ6-piperideine-2-carboxylate
 
−
** 1,6-didehydropiperidine-2-carboxylate
 
−
** 2,3,4,5-tetrahydropyridine-2-carboxylate
 
−
** 1-piperideine 6-carboxylate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-8162]]
+
* With identifiers:
−
* [[RXN-10855]]
+
** 1 [[NADP]][c] '''+''' 1 [[CPD-2961]][c] '''=>''' 1 [[NADPH]][c] '''+''' 1 [[RIBULOSE-5P]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 NADP+[c] '''+''' 1 D-gluconate 6-phosphate[c] '''=>''' 1 NADPH[c] '''+''' 1 D-ribulose 5-phosphate[c] '''+''' 1 CO2[c]
−
* [[RXN-8173]]
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_7157]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_19590]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_91]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_777]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_20238]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[OXIDATIVEPENT-PWY]], pentose phosphate pathway (oxidative branch) I: [http://metacyc.org/META/NEW-IMAGE?object=OXIDATIVEPENT-PWY OXIDATIVEPENT-PWY]
 +
** '''3''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[manual]]
 +
** Source: [[manual-primary_network]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
* RHEA:
−
** [http://www.genome.jp/dbget-bin/www_bget?C00450 C00450]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10116 10116]
−
* HMDB : HMDB59657
+
* LIGAND-RXN:
−
* CHEBI:
+
** [http://www.genome.jp/dbget-bin/www_bget?R01528 R01528]
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58769 58769]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* METABOLIGHTS : MTBLC58769
+
{{#set: common name=3-hydroxyisobutyrate_mitochondrial}}
−
* PUBCHEM:
+
{{#set: common name=6-phosphogluconate_decarboxylating}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266761 45266761]
+
{{#set: common name=ORF}}
−
{{#set: smiles=C(C1(CCCC=N1))([O-])=O}}
+
{{#set: ec number=EC-1.1.1.44}}
−
{{#set: common name=(S)-2,3,4,5-tetrahydropiperidine-2-carboxylate}}
+
{{#set: gene associated=Tiso_gene_7157|Tiso_gene_19590|Tiso_gene_91|Tiso_gene_777|Tiso_gene_20238}}
−
{{#set: inchi key=InChIKey=CSDPVAKVEWETFG-YFKPBYRVSA-M}}
+
{{#set: in pathway=OXIDATIVEPENT-PWY}}
−
{{#set: molecular weight=126.135    }}
+
{{#set: reconstruction category=orthology|manual|annotation}}
−
{{#set: common name=Δ1-piperideine-6-carboxylate|Δ6-piperideine-2-carboxylate|1,6-didehydropiperidine-2-carboxylate|2,3,4,5-tetrahydropyridine-2-carboxylate|1-piperideine 6-carboxylate}}
+
{{#set: reconstruction source=manual-primary_network|annotation-in-silico_annotation|orthology-esiliculosus}}
−
{{#set: consumed by=RXN-8162|RXN-10855}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: reversible reaction associated=RXN-8173}}
+

Latest revision as of 20:06, 21 March 2018

Reaction RXN-9952

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-hydroxyisobutyrate_mitochondrial
    • 6-phosphogluconate_decarboxylating
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 NADP+[c] + 1 D-gluconate 6-phosphate[c] => 1 NADPH[c] + 1 D-ribulose 5-phosphate[c] + 1 CO2[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links






Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-9952&oldid=46017"