Difference between revisions of "3-INDOLYLGLYCOLALDEHYDE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11671 CPD-11671] == * smiles: ** C(O)CC1(=CNC2(=C1C=C(O)C=C2)) * common name: ** 5-hydroxyt...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-INDOLYLGLYCOLALDEHYDE 3-INDOLYLGLYCOLALDEHYDE] == * smiles: ** C2(=C(C1(C=CC=CC=1N2))C(O)C=O)...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-INDOLYLGLYCOLALDEHYDE 3-INDOLYLGLYCOLALDEHYDE] == |
* smiles: | * smiles: | ||
| − | ** C( | + | ** C2(=C(C1(C=CC=CC=1N2))C(O)C=O) |
* common name: | * common name: | ||
| − | ** | + | ** indole-3-glycol aldehyde |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=XKZDNWMDLGQXML-UHFFFAOYSA-N |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 175.187 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 2-hydroxy-2-(1H-indol-3-yl)acetaldehyde |
| − | + | ** 3-indoleglycol aldehyde | |
| − | + | ||
| − | + | ||
| − | ** | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-5424]] |
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439951 439951] |
* CHEMSPIDER: | * CHEMSPIDER: | ||
| − | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.388979.html 388979] |
| − | * | + | * CHEBI: |
| − | {{#set: smiles=C( | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15976 15976] |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03230 C03230] |
| − | {{#set: molecular weight= | + | {{#set: smiles=C2(=C(C1(C=CC=CC=1N2))C(O)C=O)}} |
| − | {{#set: common name= | + | {{#set: common name=indole-3-glycol aldehyde}} |
| − | {{#set: consumed by=RXN- | + | {{#set: inchi key=InChIKey=XKZDNWMDLGQXML-UHFFFAOYSA-N}} |
| − | + | {{#set: molecular weight=175.187 }} | |
| + | {{#set: common name=2-hydroxy-2-(1H-indol-3-yl)acetaldehyde|3-indoleglycol aldehyde}} | ||
| + | {{#set: consumed by=RXN-5424}} | ||
Latest revision as of 20:07, 21 March 2018
Contents
Metabolite 3-INDOLYLGLYCOLALDEHYDE
- smiles:
- C2(=C(C1(C=CC=CC=1N2))C(O)C=O)
- common name:
- indole-3-glycol aldehyde
- inchi key:
- InChIKey=XKZDNWMDLGQXML-UHFFFAOYSA-N
- molecular weight:
- 175.187
- Synonym(s):
- 2-hydroxy-2-(1H-indol-3-yl)acetaldehyde
- 3-indoleglycol aldehyde
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
