Difference between revisions of "Tiso gene 9264"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19168 CPD-19168] == * smiles: ** CCCCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O...")
 
(Created page with "Category:Gene == Gene Tiso_gene_9264 == * right end position: ** 15309 * transcription direction: ** POSITIVE * left end position: ** 12550 * centisome position: ** 78.639...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19168 CPD-19168] ==
+
== Gene Tiso_gene_9264 ==
−
* smiles:
+
* right end position:
−
** CCCCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 15309
−
* inchi key:
+
* transcription direction:
−
** InChIKey=KZLHPKRIEDLQGG-SQUPIXLDSA-J
+
** POSITIVE
−
* common name:
+
* left end position:
−
** (S)-3-hydroxy-(7Z)-hexadecenoyl-CoA
+
** 12550
−
* molecular weight:
+
* centisome position:
−
** 1015.898    
+
** 78.639015    
 
* Synonym(s):
 
* Synonym(s):
−
** (S)-3-hydroxy-16:1-Δ7-CoA
 
−
** (S)-3-hydroxy-7-cis-hexadecenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-17781]]
+
* Reaction: [[ATPASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: right end position=15309}}
−
{{#set: inchi key=InChIKey=KZLHPKRIEDLQGG-SQUPIXLDSA-J}}
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: common name=(S)-3-hydroxy-(7Z)-hexadecenoyl-CoA}}
+
{{#set: left end position=12550}}
−
{{#set: molecular weight=1015.898   }}
+
{{#set: centisome position=78.639015   }}
−
{{#set: common name=(S)-3-hydroxy-16:1-Δ7-CoA|(S)-3-hydroxy-7-cis-hexadecenoyl-CoA}}
+
{{#set: reaction associated=ATPASE-RXN}}
−
{{#set: consumed by=RXN-17781}}
+

Latest revision as of 19:38, 21 March 2018

Gene Tiso_gene_9264

  • right end position:
    • 15309
  • transcription direction:
    • POSITIVE
  • left end position:
    • 12550
  • centisome position:
    • 78.639015
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_9264&oldid=42913"