Difference between revisions of "Tiso gene 5596"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMIDAZOLE-ACETOL-P IMIDAZOLE-ACETOL-P] == * smiles: ** C1(NC=NC=1CC(COP([O-])(=O)[O-])=O) * com...")
(Created page with "Category:Gene == Gene Tiso_gene_5596 == * right end position: ** 6926 * transcription direction: ** NEGATIVE * left end position: ** 3460 * centisome position: ** 26.29179...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMIDAZOLE-ACETOL-P IMIDAZOLE-ACETOL-P] ==
+
== Gene Tiso_gene_5596 ==
−
* smiles:
+
* right end position:
−
** C1(NC=NC=1CC(COP([O-])(=O)[O-])=O)
+
** 6926
−
* common name:
+
* transcription direction:
−
** imidazole acetol-phosphate
+
** NEGATIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=YCFFMSOLUMRAMD-UHFFFAOYSA-L
+
** 3460
−
* molecular weight:
+
* centisome position:
−
** 218.105    
+
** 26.291794    
 
* Synonym(s):
 
* Synonym(s):
−
** imidazole acetol-P
 
−
** 3-(imidazol-4-yl)-2-oxopropyl phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[HISTAMINOTRANS-RXN]]
+
* Reaction: [[PROTEIN-KINASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[IMIDPHOSDEHYD-RXN]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* CAS : 99979-59-6
+
{{#set: right end position=6926}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244516 25244516]
+
{{#set: left end position=3460}}
−
* HMDB : HMDB12236
+
{{#set: centisome position=26.291794   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01267 C01267]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57766 57766]
+
−
* BIGG : imacp
+
−
{{#set: smiles=C1(NC=NC=1CC(COP([O-])(=O)[O-])=O)}}
+
−
{{#set: common name=imidazole acetol-phosphate}}
+
−
{{#set: inchi key=InChIKey=YCFFMSOLUMRAMD-UHFFFAOYSA-L}}
+
−
{{#set: molecular weight=218.105   }}
+
−
{{#set: common name=imidazole acetol-P|3-(imidazol-4-yl)-2-oxopropyl phosphate}}
+
−
{{#set: consumed by=HISTAMINOTRANS-RXN}}
+
−
{{#set: produced by=IMIDPHOSDEHYD-RXN}}
+

Latest revision as of 20:07, 21 March 2018

Gene Tiso_gene_5596

  • right end position:
    • 6926
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 3460
  • centisome position:
    • 26.291794
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_5596&oldid=46145"