Difference between revisions of "ExchangeSeed ZN+2"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-P-SERINE 3-P-SERINE] == * smiles: ** C(OP([O-])([O-])=O)C([N+])C([O-])=O * common name: ** 3-...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed_ZN+2 ExchangeSeed_ZN+2] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formu...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-P-SERINE 3-P-SERINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed_ZN+2 ExchangeSeed_ZN+2] ==
−
* smiles:
+
* direction:
−
** C(OP([O-])([O-])=O)C([N+])C([O-])=O
+
** REVERSIBLE
−
* common name:
+
−
** 3-phospho-L-serine
+
−
* inchi key:
+
−
** InChIKey=BZQFBWGGLXLEPQ-REOHCLBHSA-L
+
−
* molecular weight:
+
−
** 183.057   
+
 
* Synonym(s):
 
* Synonym(s):
−
** O-phospho-L-serine
 
−
** L-serine phosphate
 
−
** phosphoryl-L-serine
 
−
** L-seryl phosphate
 
−
** L-serine-3P
 
−
** L-serine 3-phosphate
 
−
** 3-phospho-L-serine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN0-5114]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[ZN+2]][C-BOUNDARY] '''<=>''' 1.0 [[ZN+2]][e]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[PSERTRANSAM-RXN]]
+
** 1.0 Zn2+[C-BOUNDARY] '''<=>''' 1.0 Zn2+[e]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[manual]]
 +
** Source: [[manual-import_from_medium]]
 +
*** Comment: [[added to manage seeds from boundary to extracellular compartment]]
 
== External links  ==
 
== External links  ==
−
* CAS : 407-41-0
+
{{#set: direction=REVERSIBLE}}
−
* CAS : 17885-08-4
+
{{#set: in pathway=}}
−
* PUBCHEM:
+
{{#set: reconstruction category=manual}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7059387 7059387]
+
{{#set: reconstruction source=manual-import_from_medium}}
−
* HMDB : HMDB00272
+
{{#set: reconstruction comment=added to manage seeds from boundary to extracellular compartment}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C01005 C01005]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.5415612.html 5415612]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57524 57524]
+
−
* BIGG : pser__L
+
−
{{#set: smiles=C(OP([O-])([O-])=O)C([N+])C([O-])=O}}
+
−
{{#set: common name=3-phospho-L-serine}}
+
−
{{#set: inchi key=InChIKey=BZQFBWGGLXLEPQ-REOHCLBHSA-L}}
+
−
{{#set: molecular weight=183.057    }}
+
−
{{#set: common name=O-phospho-L-serine|L-serine phosphate|phosphoryl-L-serine|L-seryl phosphate|L-serine-3P|L-serine 3-phosphate|3-phospho-L-serine}}
+
−
{{#set: consumed by=RXN0-5114}}
+
−
{{#set: reversible reaction associated=PSERTRANSAM-RXN}}
+

Latest revision as of 20:09, 21 March 2018

Reaction ExchangeSeed_ZN+2

  • direction:
    • REVERSIBLE
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 Zn2+[C-BOUNDARY] <=> 1.0 Zn2+[e]

Genes associated with this reaction

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=ExchangeSeed_ZN%2B2&oldid=46347"