Difference between revisions of "CPD-308"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_13382 == * right end position: ** 4679 * transcription direction: ** POSITIVE * left end position: ** 145 * centisome position: ** 2.289594...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-308 CPD-308] == * smiles: ** C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O * commo...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-308 CPD-308] == |
| − | * | + | * smiles: |
| − | ** | + | ** C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O |
| − | * | + | * common name: |
| − | ** | + | ** D-nopaline |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=LMKYZBGVKHTLTN-NKWVEPMBSA-M |
| − | * | + | * molecular weight: |
| − | ** | + | ** 303.294 |
* Synonym(s): | * Synonym(s): | ||
| + | ** N2-(D-1,3-dicarboxypropyl)-L-arginine | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[1.5.1.19-RXN]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791983 49791983] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58074 58074] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01682 C01682] |
| + | {{#set: smiles=C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O}} | ||
| + | {{#set: common name=D-nopaline}} | ||
| + | {{#set: inchi key=InChIKey=LMKYZBGVKHTLTN-NKWVEPMBSA-M}} | ||
| + | {{#set: molecular weight=303.294 }} | ||
| + | {{#set: common name=N2-(D-1,3-dicarboxypropyl)-L-arginine}} | ||
| + | {{#set: produced by=1.5.1.19-RXN}} | ||
Latest revision as of 20:09, 21 March 2018
Contents
Metabolite CPD-308
- smiles:
- C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O
- common name:
- D-nopaline
- inchi key:
- InChIKey=LMKYZBGVKHTLTN-NKWVEPMBSA-M
- molecular weight:
- 303.294
- Synonym(s):
- N2-(D-1,3-dicarboxypropyl)-L-arginine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O" cannot be used as a page name in this wiki.
