Difference between revisions of "SINAPATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PGPPHOSPHA-RXN PGPPHOSPHA-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** protein-tyrosine_...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPATE SINAPATE] == * smiles: ** COC1(C=C(C=C(OC)C(O)=1)C=CC([O-])=O) * common name: ** sinap...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PGPPHOSPHA-RXN PGPPHOSPHA-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPATE SINAPATE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** COC1(C=C(C=C(OC)C(O)=1)C=CC([O-])=O)
 
* common name:
 
* common name:
−
** protein-tyrosine_phosphatase_mitochondrial_1
+
** sinapate
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/3.1.3.27 EC-3.1.3.27]
+
** InChIKey=PCMORTLOPMLEFB-ONEGZZNKSA-M
 +
* molecular weight:
 +
** 223.205   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3,5-dimethoxy-4-hydroxycinnamate
 +
** sinapinate
 +
** sinapinic acid
 +
** sinapic acid
 +
** 3,5-dimethoxy-4-hydroxycinnamic acid
 +
** 4-hydroxy-3,5-dimethoxycinnamate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-10919]]
−
** 1 [[L-1-PHOSPHATIDYL-GLYCEROL-P]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[L-1-PHOSPHATIDYL-GLYCEROL]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-3422]]
−
** 1 1-(3-sn-phosphatidyl)-sn-glycerol 3-phosphate[c] '''+''' 1 H2O[c] '''=>''' 1 phosphate[c] '''+''' 1 an L-1-phosphatidyl-sn-glycerol[c]
+
* [[RXN-8014]]
−
 
+
== Reaction(s) of unknown directionality ==
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_18092]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY4FS-7]], phosphatidylglycerol biosynthesis I (plastidic): [http://metacyc.org/META/NEW-IMAGE?object=PWY4FS-7 PWY4FS-7]
+
−
** '''3''' reactions found over '''4''' reactions in the full pathway
+
−
* [[PWY4FS-8]], phosphatidylglycerol biosynthesis II (non-plastidic): [http://metacyc.org/META/NEW-IMAGE?object=PWY4FS-8 PWY4FS-8]
+
−
** '''3''' reactions found over '''4''' reactions in the full pathway
+
−
* [[PWY-5269]], cardiolipin biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5269 PWY-5269]
+
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-7817]], type I lipoteichoic acid biosynthesis (S. aureus): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7817 PWY-7817]
+
−
** '''7''' reactions found over '''16''' reactions in the full pathway
+
−
* [[PWY-5668]], cardiolipin biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5668 PWY-5668]
+
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY0-1545]], cardiolipin biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1545 PWY0-1545]
+
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16725 16725]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54710960 54710960]
−
* LIGAND-RXN:
+
* CAS : 530-59-6
−
** [http://www.genome.jp/dbget-bin/www_bget?R02029 R02029]
+
* NCI:
−
* UNIPROT:
+
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=59261 59261]
−
** [http://www.uniprot.org/uniprot/P18200 P18200]
+
* HMDB : HMDB32616
−
** [http://www.uniprot.org/uniprot/Q9JRA8 Q9JRA8]
+
* LIGAND-CPD:
−
** [http://www.uniprot.org/uniprot/Q9PM65 Q9PM65]
+
** [http://www.genome.jp/dbget-bin/www_bget?C00482 C00482]
−
** [http://www.uniprot.org/uniprot/P0A924 P0A924]
+
* CHEMSPIDER:
−
{{#set: direction=LEFT-TO-RIGHT}}
+
** [http://www.chemspider.com/Chemical-Structure.4573878.html 4573878]
−
{{#set: common name=protein-tyrosine_phosphatase_mitochondrial_1}}
+
* CHEBI:
−
{{#set: ec number=EC-3.1.3.27}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30023 30023]
−
{{#set: gene associated=Tiso_gene_18092}}
+
{{#set: smiles=COC1(C=C(C=C(OC)C(O)=1)C=CC([O-])=O)}}
−
{{#set: in pathway=PWY4FS-7|PWY4FS-8|PWY-5269|PWY-7817|PWY-5668|PWY0-1545}}
+
{{#set: common name=sinapate}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: inchi key=InChIKey=PCMORTLOPMLEFB-ONEGZZNKSA-M}}
−
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}}
+
{{#set: molecular weight=223.205    }}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=3,5-dimethoxy-4-hydroxycinnamate|sinapinate|sinapinic acid|sinapic acid|3,5-dimethoxy-4-hydroxycinnamic acid|4-hydroxy-3,5-dimethoxycinnamate}}
 +
{{#set: consumed by=RXN-10919}}
 +
{{#set: produced by=RXN-3422|RXN-8014}}

Latest revision as of 21:10, 21 March 2018

Metabolite SINAPATE

  • smiles:
    • COC1(C=C(C=C(OC)C(O)=1)C=CC([O-])=O)
  • common name:
    • sinapate
  • inchi key:
    • InChIKey=PCMORTLOPMLEFB-ONEGZZNKSA-M
  • molecular weight:
    • 223.205
  • Synonym(s):
    • 3,5-dimethoxy-4-hydroxycinnamate
    • sinapinate
    • sinapinic acid
    • sinapic acid
    • 3,5-dimethoxy-4-hydroxycinnamic acid
    • 4-hydroxy-3,5-dimethoxycinnamate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"COC1(C=C(C=C(OC)C(O)=1)C=CC([O-])=O)" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=SINAPATE&oldid=46509"