Difference between revisions of "CPD-15104"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-cis-D21-39-C58-2-ACPs cis-cis-D21-39-C58-2-ACPs] == * common name: ** a cis,cis-delta21,39-...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15104 CPD-15104] == * smiles: ** CCC(O)(C)C(=O)C(=O)[O-] * common name: ** (R)-3-hydroxy-3-...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-cis-D21-39-C58-2-ACPs cis-cis-D21-39-C58-2-ACPs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15104 CPD-15104] ==
 +
* smiles:
 +
** CCC(O)(C)C(=O)C(=O)[O-]
 
* common name:
 
* common name:
** a cis,cis-delta21,39-C58:2-[acp]
+
** (R)-3-hydroxy-3-methyl-2-oxopentanoate
 +
* inchi key:
 +
** InChIKey=YJVOWRAWFXRESP-ZCFIWIBFSA-M
 +
* molecular weight:
 +
** 145.135   
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[R05068]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN1G-679]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-14106]]
 
== External links  ==
 
== External links  ==
{{#set: common name=a cis,cis-delta21,39-C58:2-[acp]}}
+
* PUBCHEM:
{{#set: produced by=RXN1G-679}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=20846131 20846131]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=49257 49257]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C14463 C14463]
 +
{{#set: smiles=CCC(O)(C)C(=O)C(=O)[O-]}}
 +
{{#set: common name=(R)-3-hydroxy-3-methyl-2-oxopentanoate}}
 +
{{#set: inchi key=InChIKey=YJVOWRAWFXRESP-ZCFIWIBFSA-M}}
 +
{{#set: molecular weight=145.135    }}
 +
{{#set: consumed by=R05068}}
 +
{{#set: reversible reaction associated=RXN-14106}}

Latest revision as of 20:10, 21 March 2018

Metabolite CPD-15104

  • smiles:
    • CCC(O)(C)C(=O)C(=O)[O-]
  • common name:
    • (R)-3-hydroxy-3-methyl-2-oxopentanoate
  • inchi key:
    • InChIKey=YJVOWRAWFXRESP-ZCFIWIBFSA-M
  • molecular weight:
    • 145.135
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC(O)(C)C(=O)C(=O)[O-" cannot be used as a page name in this wiki.