Difference between revisions of "Unsulfurated-Sulfur-Acceptors"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-FORMYLMETHIONINE N-FORMYLMETHIONINE] == * smiles: ** CSCCC(N[CH]=O)C(=O)[O-] * common name: *...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Unsulfurated-Sulfur-Acceptors Unsulfurated-Sulfur-Acceptors] == * common name: ** an unsulfurat...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-FORMYLMETHIONINE N-FORMYLMETHIONINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Unsulfurated-Sulfur-Acceptors Unsulfurated-Sulfur-Acceptors] ==
* smiles:
+
** CSCCC(N[CH]=O)C(=O)[O-]
+
 
* common name:
 
* common name:
** N-formyl-L-methionine
+
** an unsulfurated [sulfur carrier]
* inchi key:
+
** InChIKey=PYUSHNKNPOHWEZ-YFKPBYRVSA-M
+
* molecular weight:
+
** 176.21   
+
 
* Synonym(s):
 
* Synonym(s):
** fMet
+
** an unsulfurated [sulfur donor]
** N-formyl-methionine
+
** an unsulfurated [sulfur acceptor]
** formylmethionine
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[FORMYLMETHIONINE-DEFORMYLASE-RXN]]
+
* [[RXN-12588]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14950]]
 +
* [[RXN0-5063]]
 +
* [[RXN0-6359]]
 +
* [[RXN-14957]]
 +
* [[RXN-14959]]
 +
* [[RXN-17472]]
 +
* [[RXN-14480]]
 +
* [[RXN0-949]]
 +
* [[2.8.1.6-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-12587]]
 
== External links  ==
 
== External links  ==
* CAS : 4289-98-9
+
{{#set: common name=an unsulfurated [sulfur carrier]}}
* DRUGBANK : DB04464
+
{{#set: common name=an unsulfurated [sulfur donor]|an unsulfurated [sulfur acceptor]}}
* PUBCHEM:
+
{{#set: consumed by=RXN-12588}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5288223 5288223]
+
{{#set: produced by=RXN-14950|RXN0-5063|RXN0-6359|RXN-14957|RXN-14959|RXN-17472|RXN-14480|RXN0-949|2.8.1.6-RXN}}
* HMDB : HMDB01015
+
{{#set: reversible reaction associated=RXN-12587}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C03145 C03145]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57809 57809]
+
{{#set: smiles=CSCCC(N[CH]=O)C(=O)[O-]}}
+
{{#set: common name=N-formyl-L-methionine}}
+
{{#set: inchi key=InChIKey=PYUSHNKNPOHWEZ-YFKPBYRVSA-M}}
+
{{#set: molecular weight=176.21    }}
+
{{#set: common name=fMet|N-formyl-methionine|formylmethionine}}
+
{{#set: consumed by=FORMYLMETHIONINE-DEFORMYLASE-RXN}}
+

Latest revision as of 20:10, 21 March 2018

Metabolite Unsulfurated-Sulfur-Acceptors

  • common name:
    • an unsulfurated [sulfur carrier]
  • Synonym(s):
    • an unsulfurated [sulfur donor]
    • an unsulfurated [sulfur acceptor]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an unsulfurated [sulfur carrier" cannot be used as a page name in this wiki.
  • "an unsulfurated [sulfur donor" cannot be used as a page name in this wiki.
  • "an unsulfurated [sulfur acceptor" cannot be used as a page name in this wiki.