Difference between revisions of "Tiso gene 8216"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8990 CPD-8990] == * smiles: ** CS(=O)CCC([N+])C(=O)[O-] * common name: ** L-methionine-(R)-...")
(Created page with "Category:Gene == Gene Tiso_gene_8216 == * right end position: ** 3586 * transcription direction: ** NEGATIVE * left end position: ** 2455 * centisome position: ** 23.52434...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8990 CPD-8990] ==
+
== Gene Tiso_gene_8216 ==
−
* smiles:
+
* right end position:
−
** CS(=O)CCC([N+])C(=O)[O-]
+
** 3586
−
* common name:
+
* transcription direction:
−
** L-methionine-(R)-S-oxide
+
** NEGATIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=QEFRNWWLZKMPFJ-ZXPFJRLXSA-N
+
** 2455
−
* molecular weight:
+
* centisome position:
−
** 165.207    
+
** 23.52434    
 
* Synonym(s):
 
* Synonym(s):
−
** L-methionine-R-sulfoxide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[1.8.4.14-RXN]]
+
* Reaction: [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=3586}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11862103 11862103]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: left end position=2455}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58773 58773]
+
{{#set: centisome position=23.52434   }}
−
* BIGG : metsox_R__L
+
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
−
{{#set: smiles=CS(=O)CCC([N+])C(=O)[O-]}}
+
−
{{#set: common name=L-methionine-(R)-S-oxide}}
+
−
{{#set: inchi key=InChIKey=QEFRNWWLZKMPFJ-ZXPFJRLXSA-N}}
+
−
{{#set: molecular weight=165.207   }}
+
−
{{#set: common name=L-methionine-R-sulfoxide}}
+
−
{{#set: consumed by=1.8.4.14-RXN}}
+

Latest revision as of 20:10, 21 March 2018

Gene Tiso_gene_8216

  • right end position:
    • 3586
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 2455
  • centisome position:
    • 23.52434
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_8216&oldid=46587"