Difference between revisions of "Tiso gene 4015"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNOSE-1P MANNOSE-1P] == * smiles: ** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * common name:...") |
(Created page with "Category:Gene == Gene Tiso_gene_4015 == * Synonym(s): == Reactions associated == * Reaction: NODOx ** Source: orthology-creinhardtii * Reaction: NODOy ** Sour...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_4015 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[NODOx]] |
− | * [[ | + | ** Source: [[orthology-creinhardtii]] |
− | + | * Reaction: [[NODOy]] | |
− | + | ** Source: [[orthology-creinhardtii]] | |
− | + | == Pathways associated == | |
− | * [[ | + | |
== External links == | == External links == | ||
− | + | {{#set: reaction associated=NODOx|NODOy}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Latest revision as of 21:11, 21 March 2018
Gene Tiso_gene_4015
- Synonym(s):
Reactions associated
- Reaction: NODOx
- Source: orthology-creinhardtii
- Reaction: NODOy
- Source: orthology-creinhardtii