Difference between revisions of "CPD-8624"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11715 CPD-11715] == * smiles: ** C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1) * common name: ** phenyla...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8624 CPD-8624] == * common name: ** a [protein]-L-proline (ω = 180) * Synonym(s): **...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8624 CPD-8624] == |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a [protein]-L-proline (ω = 180) |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** a peptidylproline (ω = 180) |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[PEPTIDYLPROLYL-ISOMERASE-RXN]] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a [protein]-L-proline (ω = 180)}} | |
− | + | {{#set: common name=a peptidylproline (ω = 180)}} | |
− | + | {{#set: reversible reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 21:11, 21 March 2018
Contents
Metabolite CPD-8624
- common name:
- a [protein]-L-proline (ω = 180)
- Synonym(s):
- a peptidylproline (ω = 180)
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a [protein]-L-proline (ω = 180)" cannot be used as a page name in this wiki.