Difference between revisions of "CPD-15616"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_4685 == * right end position: ** 8084 * transcription direction: ** POSITIVE * left end position: ** 2619 * centisome position: ** 18.03346...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15616 CPD-15616] == * smiles: ** C(O)C(=O)C(O)C(O)C(O)CO * common name: ** keto-L-sorbose *...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15616 CPD-15616] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(O)C(=O)C(O)C(O)C(O)CO |
| − | * | + | * common name: |
| − | ** | + | ** keto-L-sorbose |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=BJHIKXHVCXFQLS-OTWZMJIISA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 180.157 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-14811]] | |
| − | + | * [[L-IDITOL-2-DEHYDROGENASE-RXN]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6904 6904] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=13172 13172] |
| − | {{#set: reaction associated= | + | * METABOLIGHTS : MTBLC13172 |
| − | + | {{#set: smiles=C(O)C(=O)C(O)C(O)C(O)CO}} | |
| + | {{#set: common name=keto-L-sorbose}} | ||
| + | {{#set: inchi key=InChIKey=BJHIKXHVCXFQLS-OTWZMJIISA-N}} | ||
| + | {{#set: molecular weight=180.157 }} | ||
| + | {{#set: reversible reaction associated=RXN-14811|L-IDITOL-2-DEHYDROGENASE-RXN}} | ||
Latest revision as of 20:12, 21 March 2018
Contents
Metabolite CPD-15616
- smiles:
- C(O)C(=O)C(O)C(O)C(O)CO
- common name:
- keto-L-sorbose
- inchi key:
- InChIKey=BJHIKXHVCXFQLS-OTWZMJIISA-N
- molecular weight:
- 180.157
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
