Difference between revisions of "CPD-637"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PEPSYNTH-RXN PEPSYNTH-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.o...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-637 CPD-637] == * smiles: ** CC1(C(=C(C=CC=1)O)C([O-])=O) * common name: ** 6-methylsalicyl...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PEPSYNTH-RXN PEPSYNTH-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-637 CPD-637] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC1(C(=C(C=CC=1)O)C([O-])=O)
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/2.7.9.2 EC-2.7.9.2]
+
** 6-methylsalicylate
 +
* inchi key:
 +
** InChIKey=HCJMNOSIAGSZBM-UHFFFAOYSA-M
 +
* molecular weight:
 +
** 151.141   
 
* Synonym(s):
 
* Synonym(s):
 +
** Methylsalicylic acid
 +
** 6-Methyl 2-hydroxybenzenecarboxylate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[ATP]][c] '''+''' 1 [[PYRUVATE]][c] '''+''' 1 [[WATER]][c] '''=>''' 2 [[PROTON]][c] '''+''' 1 [[Pi]][c] '''+''' 1 [[AMP]][c] '''+''' 1 [[PHOSPHO-ENOL-PYRUVATE]][c]
+
* [[2.3.1.165-RXN]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 ATP[c] '''+''' 1 pyruvate[c] '''+''' 1 H2O[c] '''=>''' 2 H+[c] '''+''' 1 phosphate[c] '''+''' 1 AMP[c] '''+''' 1 phosphoenolpyruvate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[P23-PWY]], reductive TCA cycle I: [http://metacyc.org/META/NEW-IMAGE?object=P23-PWY P23-PWY]
+
−
** '''7''' reactions found over '''12''' reactions in the full pathway
+
−
* [[PWY-5484]], glycolysis II (from fructose 6-phosphate): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5484 PWY-5484]
+
−
** '''11''' reactions found over '''11''' reactions in the full pathway
+
−
* [[GLUCONEO-PWY]], gluconeogenesis I: [http://metacyc.org/META/NEW-IMAGE?object=GLUCONEO-PWY GLUCONEO-PWY]
+
−
** '''13''' reactions found over '''13''' reactions in the full pathway
+
−
* [[GLYCOLYSIS]], glycolysis I (from glucose 6-phosphate): [http://metacyc.org/META/NEW-IMAGE?object=GLYCOLYSIS GLYCOLYSIS]
+
−
** '''12''' reactions found over '''12''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11364 11364]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54693536 54693536]
−
* LIGAND-RXN:
+
* CHEMSPIDER:
−
** [http://www.genome.jp/dbget-bin/www_bget?R00199 R00199]
+
** [http://www.chemspider.com/Chemical-Structure.5342108.html 5342108]
−
* UNIPROT:
+
* CHEBI:
−
** [http://www.uniprot.org/uniprot/P56070 P56070]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=36658 36658]
−
** [http://www.uniprot.org/uniprot/O57830 O57830]
+
* LIGAND-CPD:
−
** [http://www.uniprot.org/uniprot/Q9ZMV4 Q9ZMV4]
+
** [http://www.genome.jp/dbget-bin/www_bget?C02657 C02657]
−
** [http://www.uniprot.org/uniprot/Q9YEC5 Q9YEC5]
+
{{#set: smiles=CC1(C(=C(C=CC=1)O)C([O-])=O)}}
−
** [http://www.uniprot.org/uniprot/Q57962 Q57962]
+
{{#set: common name=6-methylsalicylate}}
−
** [http://www.uniprot.org/uniprot/O29548 O29548]
+
{{#set: inchi key=InChIKey=HCJMNOSIAGSZBM-UHFFFAOYSA-M}}
−
** [http://www.uniprot.org/uniprot/Q9V2H7 Q9V2H7]
+
{{#set: molecular weight=151.141    }}
−
** [http://www.uniprot.org/uniprot/O27190 O27190]
+
{{#set: common name=Methylsalicylic acid|6-Methyl 2-hydroxybenzenecarboxylate}}
−
** [http://www.uniprot.org/uniprot/O67899 O67899]
+
{{#set: produced by=2.3.1.165-RXN}}
−
** [http://www.uniprot.org/uniprot/Q9JVI5 Q9JVI5]
+
−
** [http://www.uniprot.org/uniprot/P42850 P42850]
+
−
** [http://www.uniprot.org/uniprot/P23538 P23538]
+
−
** [http://www.uniprot.org/uniprot/P46893 P46893]
+
−
** [http://www.uniprot.org/uniprot/Q55905 Q55905]
+
−
** [http://www.uniprot.org/uniprot/O83026 O83026]
+
−
{{#set: direction=LEFT-TO-RIGHT}}
+
−
{{#set: ec number=EC-2.7.9.2}}
+
−
{{#set: in pathway=P23-PWY|PWY-5484|GLUCONEO-PWY|GLYCOLYSIS}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+

Latest revision as of 20:12, 21 March 2018

Metabolite CPD-637

  • smiles:
    • CC1(C(=C(C=CC=1)O)C([O-])=O)
  • common name:
    • 6-methylsalicylate
  • inchi key:
    • InChIKey=HCJMNOSIAGSZBM-UHFFFAOYSA-M
  • molecular weight:
    • 151.141
  • Synonym(s):
    • Methylsalicylic acid
    • 6-Methyl 2-hydroxybenzenecarboxylate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC1(C(=C(C=CC=1)O)C([O-])=O)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-637&oldid=46781"