Difference between revisions of "Uracil-54-in-tRNA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7025 CPD-7025] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C * common name:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Uracil-54-in-tRNA Uracil-54-in-tRNA] == * common name: ** a uracil54 in tRNA * Synonym(s): ** a...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Uracil-54-in-tRNA Uracil-54-in-tRNA] == |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a uracil54 in tRNA |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** a tRNA containing uracil at position 54 |
+ | ** a tRNA uracil54 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[TRNA-URACIL-5--METHYLTRANSFERASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a uracil54 in tRNA}} | |
− | + | {{#set: common name=a tRNA containing uracil at position 54|a tRNA uracil54}} | |
− | + | {{#set: consumed by=TRNA-URACIL-5--METHYLTRANSFERASE-RXN}} | |
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 21:12, 21 March 2018
Contents
Metabolite Uracil-54-in-tRNA
- common name:
- a uracil54 in tRNA
- Synonym(s):
- a tRNA containing uracil at position 54
- a tRNA uracil54