Difference between revisions of "Tiso gene 10069"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORYL-CHOLINE PHOSPHORYL-CHOLINE] == * smiles: ** C[N+](CCOP([O-])([O-])=O)(C)C * common n...") |
(Created page with "Category:Gene == Gene Tiso_gene_10069 == * right end position: ** 9581 * transcription direction: ** NEGATIVE * left end position: ** 6708 * centisome position: ** 34.1009...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_10069 == |
− | * | + | * right end position: |
− | ** | + | ** 9581 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 6708 |
− | * | + | * centisome position: |
− | ** | + | ** 34.10096 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[3.4.24.59-RXN]] | |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[ | + | *** Assignment: automated-name-match |
− | * | + | == Pathways associated == |
− | == | + | |
== External links == | == External links == | ||
− | + | {{#set: right end position=9581}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=6708}} | |
− | + | {{#set: centisome position=34.10096 }} | |
− | + | {{#set: reaction associated=3.4.24.59-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:13, 21 March 2018
Gene Tiso_gene_10069
- right end position:
- 9581
- transcription direction:
- NEGATIVE
- left end position:
- 6708
- centisome position:
- 34.10096
- Synonym(s):
Reactions associated
- Reaction: 3.4.24.59-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation