Difference between revisions of "CPD-9459"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_1914 == * Synonym(s): == Reactions associated == * Reaction: ATPASE-RXN ** Source: annotation-in-silico_annotation *** Assignment:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9459 CPD-9459] == * smiles: ** CC3(C[CH]4(C2(=CC[CH]5(C1(CCC(C([CH]1CCC(C2(CCC(CC3)4C([O-])...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9459 CPD-9459] == |
+ | * smiles: | ||
+ | ** CC3(C[CH]4(C2(=CC[CH]5(C1(CCC(C([CH]1CCC(C2(CCC(CC3)4C([O-])=O)C)5C)(C)C)O)C))))C | ||
+ | * common name: | ||
+ | ** oleanolate | ||
+ | * inchi key: | ||
+ | ** InChIKey=MIJYXULNPSFWEK-GTOFXWBISA-M | ||
+ | * molecular weight: | ||
+ | ** 455.699 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** oleanolic acid | ||
+ | ** oleanic acid | ||
+ | ** caryophyllin | ||
+ | ** 3-beta-Hydroxyolean-12-en-28-oic acid | ||
+ | ** oleonolic acid | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-9000]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11865404 11865404] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.10039737.html 10039737] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=82828 82828] | ||
+ | * METABOLIGHTS : MTBLC37659 | ||
+ | * HMDB : HMDB02364 | ||
+ | {{#set: smiles=CC3(C[CH]4(C2(=CC[CH]5(C1(CCC(C([CH]1CCC(C2(CCC(CC3)4C([O-])=O)C)5C)(C)C)O)C))))C}} | ||
+ | {{#set: common name=oleanolate}} | ||
+ | {{#set: inchi key=InChIKey=MIJYXULNPSFWEK-GTOFXWBISA-M}} | ||
+ | {{#set: molecular weight=455.699 }} | ||
+ | {{#set: common name=oleanolic acid|oleanic acid|caryophyllin|3-beta-Hydroxyolean-12-en-28-oic acid|oleonolic acid}} | ||
+ | {{#set: consumed by=RXN-9000}} |
Latest revision as of 20:14, 21 March 2018
Contents
Metabolite CPD-9459
- smiles:
- CC3(C[CH]4(C2(=CC[CH]5(C1(CCC(C([CH]1CCC(C2(CCC(CC3)4C([O-])=O)C)5C)(C)C)O)C))))C
- common name:
- oleanolate
- inchi key:
- InChIKey=MIJYXULNPSFWEK-GTOFXWBISA-M
- molecular weight:
- 455.699
- Synonym(s):
- oleanolic acid
- oleanic acid
- caryophyllin
- 3-beta-Hydroxyolean-12-en-28-oic acid
- oleonolic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC3(C[CH]4(C2(=CC[CH]5(C1(CCC(C([CH]1CCC(C2(CCC(CC3)4C([O-])=O)C)5C)(C)C)O)C))))C" cannot be used as a page name in this wiki.