Difference between revisions of "CPD0-1812"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_14707 == * Synonym(s): == Reactions associated == * Reaction: 1.14.11.18-RXN ** Source: orthology-esiliculosus * Reaction: RXN66...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1812 CPD0-1812] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OC(CO)CO * common name: ** 2-oleoyl...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1812 CPD0-1812] == |
+ | * smiles: | ||
+ | ** CCCCCCCCC=CCCCCCCCC(=O)OC(CO)CO | ||
+ | * common name: | ||
+ | ** 2-oleoylglycerol | ||
+ | * inchi key: | ||
+ | ** InChIKey=UPWGQKDVAURUGE-KTKRTIGZSA-N | ||
+ | * molecular weight: | ||
+ | ** 356.545 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 2-mono-C18:1 | ||
+ | ** 2-monoolein | ||
+ | ** 2-monooleoylglycerol | ||
+ | ** 2-glyceryl monooleate | ||
+ | ** 1,3-dihydroxypropan-2-yl oleate | ||
+ | ** 2-(9Z)-octadecenoylglycerol | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-15088]] |
− | + | * [[RXN-15091]] | |
− | * | + | * [[RXN-15090]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | == | + | == Reaction(s) of unknown directionality == |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIPID_MAPS : LMGL01010024 |
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5319879 5319879] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73990 73990] | ||
+ | * METABOLIGHTS : MTBLC73990 | ||
+ | * HMDB : HMDB11537 | ||
+ | {{#set: smiles=CCCCCCCCC=CCCCCCCCC(=O)OC(CO)CO}} | ||
+ | {{#set: common name=2-oleoylglycerol}} | ||
+ | {{#set: inchi key=InChIKey=UPWGQKDVAURUGE-KTKRTIGZSA-N}} | ||
+ | {{#set: molecular weight=356.545 }} | ||
+ | {{#set: common name=2-mono-C18:1|2-monoolein|2-monooleoylglycerol|2-glyceryl monooleate|1,3-dihydroxypropan-2-yl oleate|2-(9Z)-octadecenoylglycerol}} | ||
+ | {{#set: consumed by=RXN-15088|RXN-15091|RXN-15090}} |
Latest revision as of 21:14, 21 March 2018
Contents
Metabolite CPD0-1812
- smiles:
- CCCCCCCCC=CCCCCCCCC(=O)OC(CO)CO
- common name:
- 2-oleoylglycerol
- inchi key:
- InChIKey=UPWGQKDVAURUGE-KTKRTIGZSA-N
- molecular weight:
- 356.545
- Synonym(s):
- 2-mono-C18:1
- 2-monoolein
- 2-monooleoylglycerol
- 2-glyceryl monooleate
- 1,3-dihydroxypropan-2-yl oleate
- 2-(9Z)-octadecenoylglycerol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links