Difference between revisions of "CPD-13043"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_7308 == * right end position: ** 7718 * transcription direction: ** NEGATIVE * left end position: ** 837 * centisome position: ** 7.392034...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13043 CPD-13043] == * smiles: ** C12(=C(C(C([O-])=O)=CN1)C(=O)NC(N)=N2) * common name: ** 7...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13043 CPD-13043] == |
| − | * | + | * smiles: |
| − | ** | + | ** C12(=C(C(C([O-])=O)=CN1)C(=O)NC(N)=N2) |
| − | * | + | * common name: |
| − | ** | + | ** 7-carboxy-7-deazaguanine |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=XIUIRSLBMMTDSK-UHFFFAOYSA-M |
| − | * | + | * molecular weight: |
| − | ** | + | ** 193.141 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-12093]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49852357 49852357] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61036 61036] |
| − | {{#set: | + | {{#set: smiles=C12(=C(C(C([O-])=O)=CN1)C(=O)NC(N)=N2)}} |
| − | {{#set: | + | {{#set: common name=7-carboxy-7-deazaguanine}} |
| + | {{#set: inchi key=InChIKey=XIUIRSLBMMTDSK-UHFFFAOYSA-M}} | ||
| + | {{#set: molecular weight=193.141 }} | ||
| + | {{#set: consumed by=RXN-12093}} | ||
Latest revision as of 20:14, 21 March 2018
Contents
Metabolite CPD-13043
- smiles:
- C12(=C(C(C([O-])=O)=CN1)C(=O)NC(N)=N2)
- common name:
- 7-carboxy-7-deazaguanine
- inchi key:
- InChIKey=XIUIRSLBMMTDSK-UHFFFAOYSA-M
- molecular weight:
- 193.141
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C12(=C(C(C([O-])=O)=CN1)C(=O)NC(N)=N2)" cannot be used as a page name in this wiki.
