Difference between revisions of "Tiso gene 12533"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19490 CPD-19490] == * smiles: ** CSCCCCC(C(=O)C(=O)[O-])C(=O)[O-] * common name: ** 3-isopr...") |
(Created page with "Category:Gene == Gene Tiso_gene_12533 == * right end position: ** 6912 * transcription direction: ** POSITIVE * left end position: ** 3857 * centisome position: ** 55.7450...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_12533 == |
− | * | + | * right end position: |
− | ** | + | ** 6912 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 3857 |
− | * | + | * centisome position: |
− | ** | + | ** 55.74505 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[GDR]] |
− | + | ** Source: [[orthology-creinhardtii]] | |
− | == | + | * Reaction: [[GDR_nadp]] |
− | * [[ | + | ** Source: [[orthology-creinhardtii]] |
+ | * Reaction: [[GDR_nadp_h]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Reaction: [[GDR_nadp_m]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Reaction: [[GDRh]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Reaction: [[GDRm]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Reaction: [[GLUTATHIONE-REDUCT-NADPH-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[GLUT-REDOX-PWY]] | ||
+ | * [[PWY-4081]] | ||
== External links == | == External links == | ||
− | {{#set: | + | {{#set: right end position=6912}} |
− | {{#set: | + | {{#set: transcription direction=POSITIVE}} |
− | {{#set: | + | {{#set: left end position=3857}} |
− | {{#set: | + | {{#set: centisome position=55.74505 }} |
− | {{#set: | + | {{#set: reaction associated=GDR|GDR_nadp|GDR_nadp_h|GDR_nadp_m|GDRh|GDRm|GLUTATHIONE-REDUCT-NADPH-RXN}} |
− | {{#set: | + | {{#set: pathway associated=GLUT-REDOX-PWY|PWY-4081}} |
Latest revision as of 21:15, 21 March 2018
Gene Tiso_gene_12533
- right end position:
- 6912
- transcription direction:
- POSITIVE
- left end position:
- 3857
- centisome position:
- 55.74505
- Synonym(s):
Reactions associated
- Reaction: GDR
- Source: orthology-creinhardtii
- Reaction: GDR_nadp
- Source: orthology-creinhardtii
- Reaction: GDR_nadp_h
- Source: orthology-creinhardtii
- Reaction: GDR_nadp_m
- Source: orthology-creinhardtii
- Reaction: GDRh
- Source: orthology-creinhardtii
- Reaction: GDRm
- Source: orthology-creinhardtii
- Reaction: GLUTATHIONE-REDUCT-NADPH-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation