Difference between revisions of "CPD-17701"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_13737 == * right end position: ** 5999 * transcription direction: ** POSITIVE * left end position: ** 3302 * centisome position: ** 53.9630...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17701 CPD-17701] == * smiles: ** C(OS(=O)(=O)[O-])C1(OC(O)C(NS(=O)(=O)[O-])C(O)C1OC2(C(OS([...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17701 CPD-17701] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(OS(=O)(=O)[O-])C1(OC(O)C(NS(=O)(=O)[O-])C(O)C1OC2(C(OS([O-])(=O)=O)C(O)C=C(C([O-])=O)O2)) |
| − | * | + | * common name: |
| − | ** | + | ** 4-deoxy-2-O-sulfo-β-L-erythro-hex-4-enopyranuronosyl-(1,4)-D-N-sulfoglucosamine 6-O-sulfate |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=LRPGJWKAYQRIAQ-NODFLXBDSA-J |
| − | * | + | * molecular weight: |
| − | ** | + | ** 573.426 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-16483]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820214 91820214] |
| − | {{#set: | + | {{#set: smiles=C(OS(=O)(=O)[O-])C1(OC(O)C(NS(=O)(=O)[O-])C(O)C1OC2(C(OS([O-])(=O)=O)C(O)C=C(C([O-])=O)O2))}} |
| − | {{#set: | + | {{#set: common name=4-deoxy-2-O-sulfo-β-L-erythro-hex-4-enopyranuronosyl-(1,4)-D-N-sulfoglucosamine 6-O-sulfate}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=LRPGJWKAYQRIAQ-NODFLXBDSA-J}} |
| + | {{#set: molecular weight=573.426 }} | ||
| + | {{#set: consumed by=RXN-16483}} | ||
Latest revision as of 21:15, 21 March 2018
Contents
Metabolite CPD-17701
- smiles:
- C(OS(=O)(=O)[O-])C1(OC(O)C(NS(=O)(=O)[O-])C(O)C1OC2(C(OS([O-])(=O)=O)C(O)C=C(C([O-])=O)O2))
- common name:
- 4-deoxy-2-O-sulfo-β-L-erythro-hex-4-enopyranuronosyl-(1,4)-D-N-sulfoglucosamine 6-O-sulfate
- inchi key:
- InChIKey=LRPGJWKAYQRIAQ-NODFLXBDSA-J
- molecular weight:
- 573.426
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(OS(=O)(=O)[O-])C1(OC(O)C(NS(=O)(=O)[O-])C(O)C1OC2(C(OS([O-])(=O)=O)C(O)C=C(C([O-])=O)O2))" cannot be used as a page name in this wiki.
