Difference between revisions of "CPD-330"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_18014 == * Synonym(s): == Reactions associated == * Reaction: R00476 ** Source: orthology-synechocystis * Reaction: UDPNACETYLMU...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-330 CPD-330] == * smiles: ** C(O)C(O)[CH]1(C(O)C(O)C(=O)O1) * common name: ** L-galactono-1...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-330 CPD-330] == |
| + | * smiles: | ||
| + | ** C(O)C(O)[CH]1(C(O)C(O)C(=O)O1) | ||
| + | * common name: | ||
| + | ** L-galactono-1,4-lactone | ||
| + | * inchi key: | ||
| + | ** InChIKey=SXZYCXMUPBBULW-NEEWWZBLSA-N | ||
| + | * molecular weight: | ||
| + | ** 178.141 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** L-galactono-γ-lactone | ||
| + | ** L-galactonate-γ-lactone | ||
| + | ** L-galactonic acid-γ-lactone | ||
| + | ** L-galactonic acid-g-lactone | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[GALACTONOLACTONE-DEHYDROGENASE-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-1884]] | |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | == | + | * [[RXN-13183]] |
| − | * [[ | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 1668-08-2 |
| − | {{#set: | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6857365 6857365] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.388522.html 388522] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17464 17464] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01115 C01115] | ||
| + | {{#set: smiles=C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)}} | ||
| + | {{#set: common name=L-galactono-1,4-lactone}} | ||
| + | {{#set: inchi key=InChIKey=SXZYCXMUPBBULW-NEEWWZBLSA-N}} | ||
| + | {{#set: molecular weight=178.141 }} | ||
| + | {{#set: common name=L-galactono-γ-lactone|L-galactonate-γ-lactone|L-galactonic acid-γ-lactone|L-galactonic acid-g-lactone}} | ||
| + | {{#set: consumed by=GALACTONOLACTONE-DEHYDROGENASE-RXN}} | ||
| + | {{#set: produced by=RXN-1884}} | ||
| + | {{#set: reversible reaction associated=RXN-13183}} | ||
Latest revision as of 20:15, 21 March 2018
Contents
Metabolite CPD-330
- smiles:
- C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)
- common name:
- L-galactono-1,4-lactone
- inchi key:
- InChIKey=SXZYCXMUPBBULW-NEEWWZBLSA-N
- molecular weight:
- 178.141
- Synonym(s):
- L-galactono-γ-lactone
- L-galactonate-γ-lactone
- L-galactonic acid-γ-lactone
- L-galactonic acid-g-lactone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)" cannot be used as a page name in this wiki.
