Difference between revisions of "GDPA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-LYSOPHOSPHATIDATE L-1-LYSOPHOSPHATIDATE] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GDPA GDPA] == * direction: ** LEFT-TO-RIGHT * common name: ** GDP-apyrase * Synonym(s): == Reactio...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-LYSOPHOSPHATIDATE L-1-LYSOPHOSPHATIDATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GDPA GDPA] ==
−
* smiles:
+
* direction:
−
** CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** 1-oleyl-2-lyso-phosphatidate
+
** GDP-apyrase
−
* inchi key:
+
−
** InChIKey=WRGQSWVCFNIUNZ-GDCKJWNLSA-L
+
−
* molecular weight:
+
−
** 434.509   
+
 
* Synonym(s):
 
* Synonym(s):
−
** L-2-lysophosphatidate
 
−
** lysophosphatidic acid
 
−
** LPA
 
−
** oleoyl lysophosphatidic acid
 
−
** 1-oleoyl-lyso-phosphatidic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-15043]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[GDP]][c] '''+''' 1.0 [[WATER]][c] '''=>''' 1.0 [[GMP]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[Pi]][c]
−
* [[RXN-15045]]
+
* With common name(s):
−
* [[RXN-15046]]
+
** 1.0 GDP[c] '''+''' 1.0 H2O[c] '''=>''' 1.0 GMP[c] '''+''' 1.0 H+[c] '''+''' 1.0 phosphate[c]
−
* [[RXN-15091]]
+
 
−
* [[RXN-15068]]
+
== Genes associated with this reaction  ==
−
== Reaction(s) of unknown directionality ==
+
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_12899]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173225 46173225]
+
{{#set: common name=GDP-apyrase}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_12899}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74544 74544]
+
{{#set: in pathway=}}
−
* METABOLIGHTS : MTBLC74544
+
{{#set: reconstruction category=orthology}}
−
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O}}
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
{{#set: common name=1-oleyl-2-lyso-phosphatidate}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: inchi key=InChIKey=WRGQSWVCFNIUNZ-GDCKJWNLSA-L}}
+
−
{{#set: molecular weight=434.509    }}
+
−
{{#set: common name=L-2-lysophosphatidate|lysophosphatidic acid|LPA|oleoyl lysophosphatidic acid|1-oleoyl-lyso-phosphatidic acid}}
+
−
{{#set: consumed by=RXN-15043}}
+
−
{{#set: produced by=RXN-15045|RXN-15046|RXN-15091|RXN-15068}}
+

Latest revision as of 20:15, 21 March 2018

Reaction GDPA

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • GDP-apyrase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 GDP[c] + 1.0 H2O[c] => 1.0 GMP[c] + 1.0 H+[c] + 1.0 phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=GDPA&oldid=47251"